(5aR,10bS)-2-Mesityl-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate

Catalog Number	ACM925706316
CAS	925706-31-6
Synonyms	(1S,9R)-4-(2,4,6-Trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
IUPAC Name	(1S,9R)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
Molecular Weight	419.22
Molecular Formula	C21H22BF4N3O
InChI	SWQQKCHLASULCF-WKOQGQMTSA-N
InChI Key	InChI=1S/C21H22N3O.BF4/c1-13-8-14(2)20(15(3)9-13)24-12-23-19(22-24)11-25-18-10-16-6-4-5-7-17(16)21(18)23;2-1(3,4)5/h4-9,12,18,21H,10-11H2,1-3H3;/q+1;-1/t18-,21+;/m1./s1
Purity	97%
Isomeric SMILES	[B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2C=[N+]3[C@@H]4[C@@H](CC5=CC=CC=C45)OCC3=N2)C

Q&A

What is the chemical formula for the compound with CAS number 925706-31-6?

The chemical formula is C21H22BF4N3O.

What is the molecular weight of the compound?

The molecular weight is 419.23.

What is the product name of the compound?

The product name is (5aR,10bS)-5a,10b-dihydro-2-(2,4,6-trimethylphenyl)-4H,6HIndeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium tetrafluoroborate.

What are some synonyms for the compound?

Some synonyms include (5aR,10bS)-5a,10b-dihydro-2-(2,4,6-trimethylphenyl)-4H,6HIndeno[...], (5aR,10bS)-5a,10b-Dihydro-2-(2,4,6-trimethylphenyl)-4H,6H-indeno[...], and others.

What is the storage temperature recommended for this compound?

The recommended storage temperature is under inert gas (nitrogen or Argon) at 2-8°C.

What is the HS Code for this compound?

The HS Code is 29349990.

What is the structure of the compound?

The compound has a (5aR,10bS)- configuration with a tetrafluoroborate salt.

Can this compound be stored in ambient conditions?

No, it is recommended to store it under an inert gas at a specific temperature.

Is the compound optically active?

Yes, the compound is optically active as it is mentioned with a percentage of enantiomeric excess.

How many carbon atoms are present in the compound?

The compound has 21 carbon atoms.