(5aR,10bS)-2-Phenyl-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate

Catalog Number	ACM925706361
CAS	925706-36-1
Synonyms	(1S,9R)-4-Phenyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
IUPAC Name	(1S,9R)-4-phenyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;tetrafluoroborate
Molecular Weight	377.14
Molecular Formula	C18H16BF4N3O
InChI	WHAPHEJUSIRKAF-CLRXKPRGSA-N
InChI Key	InChI=1S/C18H16N3O.BF4/c1-2-7-14(8-3-1)21-12-20-17(19-21)11-22-16-10-13-6-4-5-9-15(13)18(16)20;2-1(3,4)5/h1-9,12,16,18H,10-11H2;/q+1;-1/t16-,18+;/m1./s1
Purity	98%
Isomeric SMILES	[B-](F)(F)(F)F.C1[C@@H]2[C@H](C3=CC=CC=C31)[N+]4=CN(N=C4CO2)C5=CC=CC=C5

Q&A

What is the molecular weight of the compound with CAS number 925706-36-1?

The molecular weight of the compound is 377.15.

What is the product name of the compound?

The product name is (5aR,10bS)-5a,10b-dihydro-2-phenyl-4H,6H-Indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium tetrafluoroborate.

What are some synonyms for the compound?

Some synonyms for the compound are (5aR,10bS)-5a,10b-dihydro-2-phenyl-4H,6H-Indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium tetrafluoroborate and (+) - Indylamine alcohol phenylhydrazine triazole.

What is the chemical formula of the compound?

The chemical formula is C18H16BF4N3O.

What is the recommended storage temperature for the compound?

The recommended storage temperature is under inert gas (nitrogen or Argon) at 2-8°C.

How should the compound be stored to maintain its stability?

The compound should be stored under inert gas (nitrogen or Argon) at 2-8°C for optimal stability.

What is the HS code for the compound?

The HS Code for the compound is 29349990.

What is the specific chirality of the compound?

The compound has a chirality of (5aR,10bS).

How many nitrogen atoms are present in the compound?

There are three nitrogen atoms present in the compound.

What is the chemical structure of the compound?

The compound has a chemical structure of (5aR,10bS)-2-Phenyl-4,5a,6,10b-tetrahydro-2H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazin-11-ium tetrafluoroborate.