5-Phenyl-2,2'-bipyridine

Catalog Number	ACM156972804-1
CAS	156972-80-4
Structure
Synonyms	5-Phenyl-2-pyridin-2-ylpyridine
IUPAC Name	5-phenyl-2-pyridin-2-ylpyridine
Molecular Weight	232.28
Molecular Formula	C16H12N2
Canonical SMILES	C1=CC=C(C=C1)C2=CN=C(C=C2)C3=CC=CC=N3
InChI	OPPMNBYHIZCEGC-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H12N2/c1-2-6-13(7-3-1)14-9-10-16(18-12-14)15-8-4-5-11-17-15/h1-12H
Purity	98%+
Exact Mass	232.10000
Isomeric SMILES	C1=CC=C(C=C1)C2=CN=C(C=C2)C3=CC=CC=N3

Q&A

What is the CAS number of 5-Phenyl-2,2'-bipyridine?

The CAS number of 5-Phenyl-2,2'-bipyridine is 156972-80-4.

What is the molecular weight of 5-Phenyl-2,2'-bipyridine?

The molecular weight of 5-Phenyl-2,2'-bipyridine is 232.28.

What are some synonyms for 5-Phenyl-2,2'-bipyridine?

Some synonyms for 5-Phenyl-2,2'-bipyridine are 2,2'-Bipyridine and Cefazolin Impurity 51.

What is the molecular formula of 5-Phenyl-2,2'-bipyridine?

The molecular formula of 5-Phenyl-2,2'-bipyridine is C16H12N2.

What is the recommended storage temperature for 5-Phenyl-2,2'-bipyridine?

The recommended storage temperature for 5-Phenyl-2,2'-bipyridine is 2-8°C.

Is 5-Phenyl-2,2'-bipyridine a common chemical compound?

Yes, 5-Phenyl-2,2'-bipyridine is known in chemical research and has various applications.

What type of compound is 5-Phenyl-2,2'-bipyridine?

5-Phenyl-2,2'-bipyridine is a bipyridine compound.

Is 5-Phenyl-2,2'-bipyridine commonly used in pharmaceuticals?

5-Phenyl-2,2'-bipyridine may be used as an impurity in pharmaceuticals, such as in the production of Cefazolin.

Are there any special handling instructions for 5-Phenyl-2,2'-bipyridine?

Since no specific handling instructions are provided, it is advisable to handle 5-Phenyl-2,2'-bipyridine with care in accordance with standard chemical handling procedures.

Can 5-Phenyl-2,2'-bipyridine be stored at room temperature?

It is recommended to store 5-Phenyl-2,2'-bipyridine in a cooler environment at 2-8°C rather than at room temperature for better stability and longevity.