5-nitro-6-amino-1,10-phenanthroline

Catalog Number	ACM168646535-1
CAS	168646-53-5
Structure
Synonyms	6-nitro-1,10-Phenanthrolin-5-amine
IUPAC Name	6-nitro-1,10-phenanthrolin-5-amine
Molecular Weight	240.22
Molecular Formula	C12H8N4O2
Canonical SMILES	C1=CC2=C(C(=C3C=CC=NC3=C2N=C1)[N+](=O)[O-])N
InChI	InChI=1S/C12H8N4O2/c13-9-7-3-1-5-14-10(7)11-8(4-2-6-15-11)12(9)16(17)18/h1-6H,13H2
InChI Key	FPDWWTWQUVUMJH-UHFFFAOYSA-N
Boiling Point	510.9±45.0 ºC
Purity	99%+
Density	1.518±0.06 g/ml
Isomeric SMILES	C1=CC2=C(C(=C3C=CC=NC3=C2N=C1)[N+](=O)[O-])N

Q&A

What is the molecular weight of 5-nitro-6-amino-1,10-phenanthroline?

The molecular weight of 5-nitro-6-amino-1,10-phenanthroline is 240.22.

What is the boiling point of 5-nitro-6-amino-1,10-phenanthroline?

The boiling point of 5-nitro-6-amino-1,10-phenanthroline is predicted to be 510.9±45.0 °C.

What is the pKa value of 5-nitro-6-amino-1,10-phenanthroline?

The pKa value of 5-nitro-6-amino-1,10-phenanthroline is predicted to be 3.96±0.10.

What is the density of 5-nitro-6-amino-1,10-phenanthroline?

The density of 5-nitro-6-amino-1,10-phenanthroline is predicted to be 1.518±0.06 g/cm3.

What are the synonyms of 5-nitro-6-amino-1,10-phenanthroline?

The synonyms of 5-nitro-6-amino-1,10-phenanthroline are 6-nitro-1,10-Phenanthrolin-5-amine and 1,10-Phenanthrolin-5-amine, 6-nitro.

What is the chemical formula of 5-nitro-6-amino-1,10-phenanthroline?

The chemical formula of 5-nitro-6-amino-1,10-phenanthroline is C12H8N4O2.

What is the CAS number of 5-nitro-6-amino-1,10-phenanthroline?

The CAS number of 5-nitro-6-amino-1,10-phenanthroline is 168646-53-5.

What is the predicted boiling point range of 5-nitro-6-amino-1,10-phenanthroline?

The predicted boiling point range of 5-nitro-6-amino-1,10-phenanthroline is 510.9±45.0 °C.

What is the predicted pKa range of 5-nitro-6-amino-1,10-phenanthroline?

The predicted pKa range of 5-nitro-6-amino-1,10-phenanthroline is 3.96±0.10.

What is the predicted density range of 5-nitro-6-amino-1,10-phenanthroline?

The predicted density range of 5-nitro-6-amino-1,10-phenanthroline is 1.518±0.06 g/cm3.