5-Methyl-1-phenylisoquinoline

Catalog Number	ACM700380161
CAS	700380-16-1
Structure
Synonyms	1-Phenyl-5-Methylisoquinoline
IUPAC Name	5-methyl-1-phenylisoquinoline
Molecular Weight	219.28
Molecular Formula	C16H13N
InChI	ABZRXXLIXJOIOC-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H13N/c1-12-6-5-9-15-14(12)10-11-17-16(15)13-7-3-2-4-8-13/h2-11H,1H3
Purity	95%+
Isomeric SMILES	CC1=C2C=CN=C(C2=CC=C1)C3=CC=CC=C3

Q&A

What is the CAS number for 5-Methyl-1-phenylisoquinoline?

The CAS number for 5-Methyl-1-phenylisoquinoline is 700380-16-1.

What is the molecular weight of 5-Methyl-1-phenylisoquinoline?

The molecular weight of 5-Methyl-1-phenylisoquinoline is 219.28.

What is the product name for 5-Methyl-1-phenylisoquinoline?

The product name for 5-Methyl-1-phenylisoquinoline is 5-Methyl-1-phenylisoquinoline.

What is the synonym for 5-Methyl-1-phenylisoquinoline?

A synonym for 5-Methyl-1-phenylisoquinoline is Isoquinoline, 5-methyl-1-phenyl.

What is the chemical formula for 5-Methyl-1-phenylisoquinoline?

The chemical formula for 5-Methyl-1-phenylisoquinoline is C16H13N.

What are the elements present in the chemical formula of 5-Methyl-1-phenylisoquinoline?

The elements present in the chemical formula of 5-Methyl-1-phenylisoquinoline are Carbon, Hydrogen, and Nitrogen.

How many carbon atoms are in the chemical formula of 5-Methyl-1-phenylisoquinoline?

There are 16 carbon atoms in the chemical formula of 5-Methyl-1-phenylisoquinoline.

How many hydrogen atoms are in the chemical formula of 5-Methyl-1-phenylisoquinoline?

There are 13 hydrogen atoms in the chemical formula of 5-Methyl-1-phenylisoquinoline.

How many nitrogen atoms are in the chemical formula of 5-Methyl-1-phenylisoquinoline?

There is 1 nitrogen atom in the chemical formula of 5-Methyl-1-phenylisoquinoline.

What is the molecular structure of 5-Methyl-1-phenylisoquinoline?

The molecular structure of 5-Methyl-1-phenylisoquinoline consists of an isoquinoline ring with a methyl and phenyl group attached to it.