5-Methyl-1,10-phenanthroline

Catalog Number	ACM3002786-1
CAS	3002-78-6
Structure
Synonyms	1,10-Phenanthroline, 5-methyl-; 5-Methylphenanthroline
IUPAC Name	5-methyl-1,10-phenanthroline
Molecular Weight	194.23
Molecular Formula	C13H10N2
Canonical SMILES	CC1=CC2=C(C3=C1C=CC=N3)N=CC=C2
InChI	UJAQYOZROIFQHO-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H10N2/c1-9-8-10-4-2-6-14-12(10)13-11(9)5-3-7-15-13/h2-8H,1H3
Melting Point	113-114 °C -lit.
Purity	98%+
Appearance	Light yellow to beige powder
EC Number	221-099-9
Exact Mass	194.084398327
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	194.084398327
Rotatable Bond Count	0
Topological Polar Surface Area	25.8 Ų

Q&A

What is the chemical formula of 5-Methyl-1,10-phenanthroline?

The chemical formula of 5-Methyl-1,10-phenanthroline is C13H10N2.

What is the molecular weight of 5-Methyl-1,10-phenanthroline?

The molecular weight of 5-Methyl-1,10-phenanthroline is 194.23 g/mol.

What are some of the product categories that 5-Methyl-1,10-phenanthroline falls under?

Some of the product categories that 5-Methyl-1,10-phenanthroline falls under include Heterocyclic Building Blocks, N-Containing, Analytical Chemistry, Chelating Reagents, Phenanthrolines, and Others.

What is the appearance of 5-Methyl-1,10-phenanthroline?

5-Methyl-1,10-phenanthroline appears as a powder to crystal, ranging in color from white to light yellow to light orange.

At what temperature does 5-Methyl-1,10-phenanthroline melt?

5-Methyl-1,10-phenanthroline melts at a temperature of 113-114 °C.

What solvents is 5-Methyl-1,10-phenanthroline soluble in?

5-Methyl-1,10-phenanthroline is soluble in methanol, with a solubility of 50 mg/mL, resulting in a clear to slightly hazy, colorless to yellow solution.

What are some safety statements associated with using 5-Methyl-1,10-phenanthroline?

Some safety statements include avoiding contact with skin and eyes, and wearing suitable protective clothing during handling.

How is 5-Methyl-1,10-phenanthroline used in analytical chemistry?

5-Methyl-1,10-phenanthroline is used in the determination of Cu(II) in duralmin alloy by capillary zone electrophoresis.

How can 5-Methyl-1,10-phenanthroline be purified?

5-Methyl-1,10-phenanthroline can be crystallized from benzene/pet ether or from water as the monohydrate.

What is the hazard code associated with 5-Methyl-1,10-phenanthroline?

The hazard code associated with 5-Methyl-1,10-phenanthroline is Xn.