5-Isothiocyanato-1,10-phenanthroline

Catalog Number	ACM75618994-1
CAS	75618-99-4
Structure
Synonyms	5-Isothiocyanato-1,10-phenanthroline
IUPAC Name	5-isothiocyanato-1,10-phenanthroline
Molecular Weight	237.28
Molecular Formula	C13H7N3S
InChI	TZAFRFYNRUUPFS-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H7N3S/c17-8-16-11-7-9-3-1-5-14-12(9)13-10(11)4-2-6-15-13/h1-7H
Purity	97%
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)N=C=S

Q&A

What is the chemical formula for 5-Isothiocyanato-1,10-phenanthroline?

The chemical formula for 5-Isothiocyanato-1,10-phenanthroline is C13H7N3S.

What is the molecular weight of 5-Isothiocyanato-1,10-phenanthroline?

The molecular weight of 5-Isothiocyanato-1,10-phenanthroline is 237.28 g/mol.

What is the CAS number for 5-Isothiocyanato-1,10-phenanthroline?

The CAS number for 5-Isothiocyanato-1,10-phenanthroline is 75618-99-4.

What are the product categories that 5-Isothiocyanato-1,10-phenanthroline belongs to?

5-Isothiocyanato-1,10-phenanthroline belongs to the product category of Electronic Chemicals.

What is an alternative name for 5-Isothiocyanato-1,10-phenanthroline?

An alternative name for 5-Isothiocyanato-1,10-phenanthroline is 1,10-Phenanthroline, 5-isothiocyanato-.

How many nitrogen atoms are in the molecular formula of 5-Isothiocyanato-1,10-phenanthroline?

There are three nitrogen atoms in the molecular formula of 5-Isothiocyanato-1,10-phenanthroline.

What is the chemical structure of 5-Isothiocyanato-1,10-phenanthroline?

The chemical structure of 5-Isothiocyanato-1,10-phenanthroline is C13H7N3S.

What type of chemistry is 5-Isothiocyanato-1,10-phenanthroline commonly used in?

5-Isothiocyanato-1,10-phenanthroline is commonly used in electronic chemistry.

What type of functional group is present in 5-Isothiocyanato-1,10-phenanthroline?

The isothiocyanato functional group is present in 5-Isothiocyanato-1,10-phenanthroline.

What is the significance of the isothiocyanato group in the chemical properties of 5-Isothiocyanato-1,10-phenanthroline?

The isothiocyanato group in 5-Isothiocyanato-1,10-phenanthroline contributes to its reactivity and potential applications in various chemical reactions.