5-Iodo-1,10-phenanthroline

Catalog Number	ACM630067128
CAS	630067-12-8
Structure
Synonyms	1,10-Phenanthroline, 5-iodo-
IUPAC Name	5-iodo-1,10-phenanthroline
Molecular Weight	306.10
Molecular Formula	C12H7N2I
InChI	XJRFZOAXAPEOGO-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H7IN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H
Boiling Point	438.6±25.0 °C at 760 mmHg
Purity	98%
Isomeric SMILES	C1=CC2=CC(=C3C=CC=NC3=C2N=C1)I

Q&A

What is the CAS number for 5-Iodo-1,10-phenanthroline?

The CAS number for 5-Iodo-1,10-phenanthroline is 630067-12-8.

What is the molecular weight of 5-Iodo-1,10-phenanthroline?

The molecular weight of 5-Iodo-1,10-phenanthroline is 306.1.

What are some synonyms for 5-Iodo-1,10-phenanthroline?

Some synonyms for 5-Iodo-1,10-phenanthroline are 1,10-Phenanthroline, 5-iodo-.

What is the molecular formula of 5-Iodo-1,10-phenanthroline?

The molecular formula of 5-Iodo-1,10-phenanthroline is C12H7IN2.

What is the predicted boiling point of 5-Iodo-1,10-phenanthroline?

The predicted boiling point of 5-Iodo-1,10-phenanthroline is 438.6±25.0 °C.

How should 5-Iodo-1,10-phenanthroline be stored?

5-Iodo-1,10-phenanthroline should be stored under inert gas (nitrogen or argon) at 2-8°C.

What is the predicted density of 5-Iodo-1,10-phenanthroline?

The predicted density of 5-Iodo-1,10-phenanthroline is 1.841±0.06 g/cm3.

What is the predicted pka value of 5-Iodo-1,10-phenanthroline?

The predicted pka value of 5-Iodo-1,10-phenanthroline is 4.05±0.10.

What are some common uses of 5-Iodo-1,10-phenanthroline?

5-Iodo-1,10-phenanthroline is commonly used in chemical research and synthesis.

Are there any specific safety precautions to be aware of when handling 5-Iodo-1,10-phenanthroline?

Yes, it is important to handle 5-Iodo-1,10-phenanthroline with caution and adhere to proper safety protocols as it may have hazardous properties.