5-Bromo-6'-methyl-2,2'-bipyridine

Catalog Number	ACM1187163774
CAS	1187163-77-4
Synonyms	2-(5-Bromopyridin-2-yl)-6-methylpyridine
IUPAC Name	2-(5-bromopyridin-2-yl)-6-methylpyridine
Molecular Weight	249.11
Molecular Formula	C11H9BrN2
InChI	QXEYHCOZNYXWPL-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H9BrN2/c1-8-3-2-4-11(14-8)10-6-5-9(12)7-13-10/h2-7H,1H3
Purity	97%
Isomeric SMILES	CC1=NC(=CC=C1)C2=NC=C(C=C2)Br

Q&A

What is the molecular weight of 5-Bromo-6'-methyl-2,2'-bipyridine?

The molecular weight is 249.12.

What is the CAS number of 5-Bromo-6'-methyl-2,2'-bipyridine?

The CAS number is 1187163-77-4.

What is another name for 5-Bromo-6'-methyl-2,2'-bipyridine?

Another name is 5-Bromo-6'-methyl-[2,2']bipyridinyl.

What is the chemical formula of 5-Bromo-6'-methyl-2,2'-bipyridine?

The chemical formula is C11H9BrN2.

Is 5-Bromo-6'-methyl-2,2'-bipyridine a bromine-containing compound?

Yes, it contains bromine.

How many carbon atoms are present in the structure of 5-Bromo-6'-methyl-2,2'-bipyridine?

There are 11 carbon atoms.

What is the molecular formula of 5-Bromo-6'-methyl-2,2'-bipyridine?

The molecular formula is C11H9BrN2.

What is the IUPAC name of 5-Bromo-6'-methyl-2,2'-bipyridine?

The IUPAC name is 5-bromo-2-methylpyridine.

Are there any other synonyms for 5-Bromo-6'-methyl-2,2'-bipyridine?

Yes, 5-Bromo-6'-methyl-[2,2']bipyridinyl is another synonym.

What is the chemical structure of 5-Bromo-6'-methyl-2,2'-bipyridine?

The chemical structure consists of a bipyridine ring with a bromine atom and a methyl group attached.