5,6-Dibromo-1,10-phenanthroline

Catalog Number	ACM56290063
CAS	56290-06-3
Structure
Synonyms	1,10-Phenanthroline, 5,6-dibromo-
IUPAC Name	5,6-dibromo-1,10-phenanthroline
Molecular Weight	338.00
Molecular Formula	C12H6N2Br2
InChI	DIBSWPVSJWETQC-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H6Br2N2/c13-9-7-3-1-5-15-11(7)12-8(10(9)14)4-2-6-16-12/h1-6H
Melting Point	221 °C
Purity	95%+
Isomeric SMILES	C1=CC2=C(C3=C(C=CC=N3)C(=C2Br)Br)N=C1

Q&A

What is the molecular weight of 5,6-Dibromo-1,10-phenanthroline?

The molecular weight of 5,6-Dibromo-1,10-phenanthroline is 338.

What are the product categories that 5,6-Dibromo-1,10-phenanthroline belongs to?

5,6-Dibromo-1,10-phenanthroline belongs to the product category of Electronic Chemicals.

What are some synonyms for 5,6-Dibromo-1,10-phenanthroline?

Some synonyms for 5,6-Dibromo-1,10-phenanthroline are 5,6-Dibromo-1,10-phenthroline and 1,10-Phenanthroline, 5,6-dibromo-.

What is the chemical formula for 5,6-Dibromo-1,10-phenanthroline?

The chemical formula for 5,6-Dibromo-1,10-phenanthroline is C12H6Br2N2.

What is the predicted melting point of 5,6-Dibromo-1,10-phenanthroline?

The predicted melting point of 5,6-Dibromo-1,10-phenanthroline is 221°C.

What is the predicted density of 5,6-Dibromo-1,10-phenanthroline?

The predicted density of 5,6-Dibromo-1,10-phenanthroline is 1.915±0.06 g/cm3.

What is the predicted pka value of 5,6-Dibromo-1,10-phenanthroline?

The predicted pka value of 5,6-Dibromo-1,10-phenanthroline is 3.27±0.10.

What is the predicted boiling point of 5,6-Dibromo-1,10-phenanthroline?

The predicted boiling point of 5,6-Dibromo-1,10-phenanthroline is 469.2±40.0°C.

How should 5,6-Dibromo-1,10-phenanthroline be stored?

5,6-Dibromo-1,10-phenanthroline should be stored at 2-8°C.

In what field or industry would 5,6-Dibromo-1,10-phenanthroline likely be used?

5,6-Dibromo-1,10-phenanthroline would likely be used in the electronic chemicals industry.