5,10,15,20-Tetraphenylporphyrin

Catalog Number	ACM917237-7
CAS	917-23-7
Structure
Synonyms	meso-Tetraphenylporphyrin; TPP; 5,10,15,20-Tetraphenyl-21H,23H-porphine
IUPAC Name	5,10,15,20-tetraphenyl-21,23-dihydroporphyrin
Molecular Weight	614.74
Molecular Formula	C44H30N4
Canonical SMILES	C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)N3
InChI	YNHJECZULSZAQK-UHFFFAOYSA-N
InChI Key	InChI=1S/C44H30N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,45,48H
Melting Point	300 °C
Purity	97%
Appearance	Deep blue powder
EC Number	213-025-9
Exact Mass	614.24704697
Heavy Atom Count	48
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	614.24704697
Rotatable Bond Count	4
Topological Polar Surface Area	57.4 Ų

Q&A

What is the molecular weight of 5,10,15,20-Tetraphenylporphyrin (TPP)?

The molecular weight of TPP is 614.74.

What are the product categories of 5,10,15,20-Tetraphenylporphyrin?

The product categories include Imidazoles, Heterocyclic Acids, porphine ligand, Analytical Chemistry, Biochemistry, Chelating Reagents, Porphines, Organics, Porphyrins, Synthetic Porphyrins, Ligands for Pharmaceutical Research, Environmentally-friendly Oxidation, and Magnetic Resonance Imaging.

What is the melting point of TPP?

The melting point of TPP is 300°C.

Is 5,10,15,20-Tetraphenylporphyrin soluble in water?

No, it is insoluble in water.

What is the stability of TPP?

It is light sensitive.

What is the boiling point of TPP?

The boiling point is approximately 648.45°C.

What is the color of 5,10,15,20-Tetraphenylporphyrin?

The color ranges from blue to purple.

What is the InChIKey of TPP?

The InChIKey is YNHJECZULSZAQK-LWQDQPMZSA-N.

What are the safety statements associated with 5,10,15,20-Tetraphenylporphyrin?

Safety statements 22-24/25 and F:8-10-23.

How is TPP commonly used?

TPP is often used as a photosensitizer, to create coordination complexes with metals, as a hydrogen catalyst, and as inhibitors of microtubule assembly in human cervix carcinoma cells.