5,10,15,20-Tetrakis(2-pyridyl)porphyrine

Catalog Number	ACM40904903-3
CAS	40904-90-3
Structure
Synonyms	Meso-Tetra (2-Pyridyl) Porphine
IUPAC Name	5,10,15,20-tetrapyridin-2-yl-21,23-dihydroporphyrin
Molecular Weight	618.69
Molecular Formula	C40H26N8
InChI	SBTXZBOBSRZUPE-UHFFFAOYSA-N
InChI Key	InChI=1S/C40H26N8/c1-5-21-41-25(9-1)37-29-13-15-31(45-29)38(26-10-2-6-22-42-26)33-17-19-35(47-33)40(28-12-4-8-24-44-28)36-20-18-34(48-36)39(27-11-3-7-23-43-27)32-16-14-30(37)46-32/h1-24,45,48H
Purity	97%
Isomeric SMILES	C1=CC=NC(=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=N7)C8=CC=CC=N8)C=C4)C9=CC=CC=N9)N3

Q&A

What is the molecular weight of meso-Tetra (2-pyridyl) porphine?

The molecular weight of meso-Tetra (2-pyridyl) porphine is 618.69.

What are the product categories that meso-Tetra (2-pyridyl) porphine falls under?

The product categories include Amines, Aromatics, Heterocycles, Intermediates & Fine Chemicals, and Pharmaceuticals.

What is the chemical formula of meso-Tetra (2-pyridyl) porphine?

The chemical formula is C40H26N8.

What is the density of meso-Tetra (2-pyridyl) porphine?

The density is 1.335.

How should meso-Tetra (2-pyridyl) porphine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of meso-Tetra (2-pyridyl) porphine?

The color is purple-violet.

What is the HS Code for meso-Tetra (2-pyridyl) porphine?

The HS Code is 2933998090.

What are some synonyms for meso-Tetra (2-pyridyl) porphine?

Some synonyms include Meso-Tetrakis(2-pyridyl)porphine, meso-Tetrakis(2-pyridyl)porphyrin, and 5,10,15,20-Tetra-2-pyridylporphine.

What are the uses of meso-Tetra (2-pyridyl) porphine?

It is useful in lowering peroxynitrite levels in a cell or tissue for treatment of diseases related to physiol. damage caused by peroxynitrite.

What is the product name of 5,10,15,20-Tetrakis(2-pyridyl)porphyrine?

The product name is meso-Tetra (2-pyridyl) porphine.