ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

5,10,15,20-Tetra-2-thienyl-Porphine

Catalog Number ACM22112874-1
CAS 22112-87-4
Structure {[CurrentData.Name]}
Synonyms Tetra(2-Thienyl)Porphin; 5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin
IUPAC Name 5,10,15,20-tetrathiophen-2-yl-21,23-dihydroporphyrin
Molecular Weight 638.85
Molecular Formula C36H22N4S4
InChI QTBZIEZZDWDDFD-UHFFFAOYSA-N
InChI Key InChI=1S/C36H22N4S4/c1-5-29(41-17-1)33-21-9-11-23(37-21)34(30-6-2-18-42-30)25-13-15-27(39-25)36(32-8-4-20-44-32)28-16-14-26(40-28)35(31-7-3-19-43-31)24-12-10-22(33)38-24/h1-20,37,40H
Boiling Point >300 °C
Melting Point >300 °C
Purity 98%
Appearance Soild
Isomeric SMILES C1=CSC(=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CS7)C8=CC=CS8)C=C4)C9=CC=CS9)N3
Q&A

What is the molecular weight of 5,10,15,20-tetra-2-thienyl-Porphine?

The molecular weight is 638.85.

What is another name for 5,10,15,20-tetra-2-thienyl-Porphine?

Another name is 5,10,15,20-tetra (2-thienyl) porphyrin.

What is the chemical formula of 5,10,15,20-tetra-2-thienyl-Porphine?

The chemical formula is C36H22N4S4.

At what temperature does 5,10,15,20-tetra-2-thienyl-Porphine melt?

It melts at a temperature greater than 300 °C.

How should 5,10,15,20-tetra-2-thienyl-Porphine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 5,10,15,20-tetra-2-thienyl-Porphine?

The predicted density is 1.424±0.06 g/cm3.

What is the CAS number for 5,10,15,20-tetra-2-thienyl-Porphine?

The CAS number is 22112-87-4.

What is the full chemical name of 5,10,15,20-tetra-2-thienyl-Porphine?

The full chemical name is 21H,23H-Porphine, 5,10,15,20-tetra-2-thienyl-.

How many thienyl groups are present in 5,10,15,20-tetra-2-thienyl-Porphine?

There are four thienyl groups present.

Please kindly note that our products and services are for research use only.