(4S,4'S)-2,2'-(1-Phenylpropane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole)

Catalog Number	ACM1404433379
CAS	1404433-37-9
Structure
Synonyms	(S)-BnPh-SaBOX
IUPAC Name	(4S)-4-phenyl-2-[1-phenyl-2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	410.51
Molecular Formula	C27H26N2O2
InChI	ZTYRVDVKIHBGIV-DNQXCXABSA-N
InChI Key	InChI=1S/C27H26N2O2/c1-27(17-20-11-5-2-6-12-20,25-28-23(18-30-25)21-13-7-3-8-14-21)26-29-24(19-31-26)22-15-9-4-10-16-22/h2-16,23-24H,17-19H2,1H3/t23-,24-/m1/s1
Purity	98%
Appearance	White powder
Isomeric SMILES	CC(CC1=CC=CC=C1)(C2=N[C@H](CO2)C3=CC=CC=C3)C4=N[C@H](CO4)C5=CC=CC=C5

Q&A

What is the CAS number of the compound?

The CAS number of the compound is 1404433-37-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 410.51.

What are the product categories that the compound belongs to?

The compound belongs to the BOX series and Chiral Nitrogen product categories.

What is the product name of the compound?

The product name is (S)-BnPh-SaBOX.

What are some synonyms of the compound?

Some synonyms of the compound include (S)-BnPh-SaBOX, (4S,4'S)-2,2'-(1-Phenylpropane-2,2-diyl)bis(4-phenyl-4,5-dihydrooxazole), and (S,S)-2-Bn-Sabox-Ph.

What is the molecular formula of the compound?

The molecular formula of the compound is C27H26N2O2.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 569.4±50.0 °C.

How should the compound be stored?

The compound should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of the compound?

The predicted density of the compound is 1.16±0.1 g/cm3.

What is the chemical property of the compound?

The compound is a white powder.