(4S,4'S)-2,2'-(1,3-Di(quinolin-2-yl)propane-2,2-diyl)bis(4-benzyl-4,5-dihydrooxazole)

Catalog Number	ACM2490297237
CAS	2490297-23-7
Synonyms	(4S)-4-Benzyl-2-[2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-di(quinolin-2-yl)propan-2-yl]-4,5-dihydro-1,3-oxazole
IUPAC Name	(4S)-4-benzyl-2-[2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-1,3-di(quinolin-2-yl)propan-2-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	616.75
Molecular Formula	C41H36N4O2
InChI	CUXDQYBYYYESQB-ZPGRZCPFSA-N
InChI Key	InChI=1S/C41H36N4O2/c1-3-11-29(12-4-1)23-35-27-46-39(44-35)41(25-33-21-19-31-15-7-9-17-37(31)42-33,26-34-22-20-32-16-8-10-18-38(32)43-34)40-45-36(28-47-40)24-30-13-5-2-6-14-30/h1-22,35-36H,23-28H2/t35-,36-/m0/s1
Purity	97%
Isomeric SMILES	C1[C@@H](N=C(O1)C(CC2=NC3=CC=CC=C3C=C2)(CC4=NC5=CC=CC=C5C=C4)C6=N[C@H](CO6)CC7=CC=CC=C7)CC8=CC=CC=C8

Q&A

What is the chemical compound's CAS number?

The chemical compound's CAS number is 2490297-23-7.

What is the molecular weight of the compound?

The molecular weight of the compound is 616.77.

What is the predicted density of the compound?

The predicted density of the compound is 1.23±0.1 g/cm3.

What are the synonyms for the chemical compound?

The synonyms for the chemical compound are (4S,4'S)-2,2'-(1,3-Di(quinolin-2-yl)propane-2,2-diyl)bis(4-benzyl-4,5-dihydrooxazole).

What is the molecular formula of the compound?

The molecular formula of the compound is C41H36N4O2.

What is the predicted boiling point of the compound?

The predicted boiling point of the compound is 773.9±60.0 °C.

What is the predicted pka value of the compound?

The predicted pka value of the compound is 5.18±0.70.