What is the molecular formula of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
The molecular formula is C20H19FeNO.
What is the exact mass of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
The exact mass is 345.081600 g/mol.
How many hydrogen bond acceptor counts does [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene have?
It has 3 hydrogen bond acceptor counts.
What is the canonical SMILES representation of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
C1C([N-]C(=C2C=CC=C2)O1)CC3=CC=CC=C3.[CH-]1C=CC=C1.[Fe+2]
How many heavy atoms are present in the structure of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
There are 23 heavy atoms.
What is the IUPAC name of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
The IUPAC name is (4S)-4-benzyl-2-cyclopenta-2,4-dien-1-ylidene-1,3-oxazolidin-3-ide;cyclopenta-1,3-diene;iron(2+)
How many covalently-bonded units are present in [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
There are 3 covalently-bonded units.
What are the depositor-supplied synonyms for [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
Some synonyms are 162157-05-3, E81133, and Ferrocene, [(4S)-4,5-dihydro-4-(phenylmethyl)-2-oxazolyl]-.
Is there a formal charge present in the computed properties of [(4S)-4,5-Dihydro-4-phenylmethyl-2-oxazolyl]ferrocene?
No, there is no formal charge in the computed properties.