4'-Phenyl-2,2':6',2''-terpyridine

Catalog Number	ACM58345974-1
CAS	58345-97-4
Structure
Synonyms	4-Phenyl-2,6-dipyridin-2-ylpyridine
IUPAC Name	2-(4-ethenylpyridin-2-yl)-4-methylpyridine
Molecular Weight	309.36
Molecular Formula	C21H15N3
InChI	IWZAEAAZXRSXPX-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H12N2/c1-3-11-5-7-15-13(9-11)12-8-10(2)4-6-14-12/h3-9H,1H2,2H3
Purity	98%
Isomeric SMILES	CC1=CC(=NC=C1)C2=NC=CC(=C2)C=C

Q&A

What is the molecular weight of 4'-Phenyl-2,2':6',2''-terpyridine?

The molecular weight of 4'-Phenyl-2,2':6',2''-terpyridine is 309.36 g/mol.

What are the product categories that 4'-Phenyl-2,2':6',2''-terpyridine belongs to?

4'-Phenyl-2,2':6',2''-terpyridine belongs to MOFS and COFS product categories.

What are some synonyms of 4'-Phenyl-2,2':6',2''-terpyridine?

Some synonyms of 4'-Phenyl-2,2':6',2''-terpyridine include 4-PHENYL-2,6-BIS(PYRIDIN-2-YL)PYRIDINE and 2,2':6',2''-Terpyridine, 4'-phenyl-.

What is the chemical formula of 4'-Phenyl-2,2':6',2''-terpyridine?

The chemical formula of 4'-Phenyl-2,2':6',2''-terpyridine is C21H15N3.

What is the predicted melting point of 4'-Phenyl-2,2':6',2''-terpyridine?

The predicted melting point of 4'-Phenyl-2,2':6',2''-terpyridine is 208 °C.

What is the predicted density of 4'-Phenyl-2,2':6',2''-terpyridine?

The predicted density of 4'-Phenyl-2,2':6',2''-terpyridine is 1.167±0.06 g/cm3.

What is the predicted boiling point of 4'-Phenyl-2,2':6',2''-terpyridine?

The predicted boiling point of 4'-Phenyl-2,2':6',2''-terpyridine is 475.2±40.0 °C.

What is the predicted pka value of 4'-Phenyl-2,2':6',2''-terpyridine?

The predicted pka value of 4'-Phenyl-2,2':6',2''-terpyridine is 4.56±0.22.

What percentage of purity is indicated for 4'-Phenyl-2,2':6',2''-terpyridine?

The purity indicated for 4'-Phenyl-2,2':6',2''-terpyridine is 97%+.

What is the full name of the chemical compound with the abbreviation MF?

The full name of the chemical compound with the abbreviation MF is C21H15N3, which represents 4'-Phenyl-2,2':6',2''-terpyridine.