ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

4-Methyl-4'-vinyl-2,2'-bipyridine

Catalog Number ACM74173481
CAS 74173-48-1
Structure {[CurrentData.Name]}
Synonyms 2-(4-Ethenylpyridin-2-yl)-4-methylpyridine; 4-Vinyl-4'-methyl-2,2'-bipyridine
IUPAC Name 2-(4-ethenylpyridin-2-yl)-4-methylpyridine
Molecular Weight 196.25
Molecular Formula C13H12N2
InChI IWZAEAAZXRSXPX-UHFFFAOYSA-N
InChI Key InChI=1S/C13H12N2/c1-3-11-5-7-15-13(9-11)12-8-10(2)4-6-14-12/h3-9H,1H2,2H3
Boiling Point 347.3±30.0 °C(Predicted)
Purity 97%
Isomeric SMILES CC1=CC(=NC=C1)C2=NC=CC(=C2)C=C
Q&A

What is the CAS number for 4-Methyl-4'-vinyl-2,2'-bipyridine?

The CAS number for 4-Methyl-4'-vinyl-2,2'-bipyridine is 74173-48-1.

What is the molecular weight of 4-Methyl-4'-vinyl-2,2'-bipyridine?

The molecular weight of 4-Methyl-4'-vinyl-2,2'-bipyridine is 196.25.

What are some synonyms for 4-Methyl-4'-vinyl-2,2'-bipyridine?

Some synonyms for 4-Methyl-4'-vinyl-2,2'-bipyridine are 4-Ethenyl-4'-methyl-2,2'-bipyridine, 4-Vinyl-4'-methyl-2,2'-bipyridine, and 4'-Methyl-4-vinyl-[2,2']bipyridinyl.

What is the chemical formula of 4-Methyl-4'-vinyl-2,2'-bipyridine?

The chemical formula of 4-Methyl-4'-vinyl-2,2'-bipyridine is C13H12N2.

What is the predicted boiling point of 4-Methyl-4'-vinyl-2,2'-bipyridine?

The predicted boiling point of 4-Methyl-4'-vinyl-2,2'-bipyridine is 347.3±30.0 °C.

How should 4-Methyl-4'-vinyl-2,2'-bipyridine be stored?

4-Methyl-4'-vinyl-2,2'-bipyridine should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 4-Methyl-4'-vinyl-2,2'-bipyridine?

The predicted density of 4-Methyl-4'-vinyl-2,2'-bipyridine is 1.070±0.06 g/cm3.

What is the predicted pka value of 4-Methyl-4'-vinyl-2,2'-bipyridine?

The predicted pka value of 4-Methyl-4'-vinyl-2,2'-bipyridine is 4.68±0.30.

What are some other names or identifiers for 4-Methyl-4'-vinyl-2,2'-bipyridine?

Other names or identifiers for 4-Methyl-4'-vinyl-2,2'-bipyridine include 2-(4-ethenylpyridin-2-yl)-4-methylpyridine and 2,2'-Bipyridine, 4-ethenyl-4'-methyl-.

Please kindly note that our products and services are for research use only.