ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine

Catalog Number ACM114527285
CAS 114527-28-5
Structure {[CurrentData.Name]}
Synonyms 4-(4'-Methyl-[2,2'-Bipyridin]-4-Yl)Butanoic Acid; 4-[2-(4-methylpyridin-2-yl)pyridin-4-yl]butanoic acid
IUPAC Name 4-[2-(4-methylpyridin-2-yl)pyridin-4-yl]butanoic acid
Molecular Weight 256.30
Molecular Formula C15H16N2O2
InChI LFMPLEMXVCGLMX-UHFFFAOYSA-N
InChI Key InChI=1S/C15H16N2O2/c1-11-5-7-16-13(9-11)14-10-12(6-8-17-14)3-2-4-15(18)19/h5-10H,2-4H2,1H3,(H,18,19)
Purity 98%
Isomeric SMILES CC1=CC(=NC=C1)C2=NC=CC(=C2)CCCC(=O)O
Q&A

What is the chemical formula for 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The chemical formula is C15H16N2O2.

What is the molecular weight of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The molecular weight is 256.3.

What is the melting point of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The melting point is 107-109 °C.

What is the predicted density of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The predicted density is 1.176±0.06 g/cm3.

What is the predicted pka value of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The predicted pka value is 4.58±0.10.

What is the predicted boiling point of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The predicted boiling point is 447.4±40.0 °C.

What are some synonyms for 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

Some synonyms are 4-(4'-Methyl-[2,2'-bipyridin]-4-yl)butanoic acid and 4'-Methyl[2,2'-bipyridine]-4-butanoic acid.

How should 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine be stored?

It should be stored in an inert atmosphere at room temperature.

What is the CAS number for 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The CAS number is 114527-28-5.

What is the molecular formula of 4-Methyl-4'-(3-carboxypropyl)-2,2'-bipyridine?

The molecular formula is C15H16N2O2.

Please kindly note that our products and services are for research use only.