4-Methyl-2-phenylpyridine

Catalog Number	ACM3475216-1
CAS	3475-21-6
Structure
Synonyms	2-Phenyl-4-picoline
IUPAC Name	4-methyl-2-phenylpyridine
Molecular Weight	169.22
Molecular Formula	C12H11N
Canonical SMILES	CC1=CC(=NC=C1)C2=CC=CC=C2
InChI	WWMRJCUZPJJWBC-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H11N/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h2-9H,1H3
Boiling Point	284.5ºC at 760 mmHg
Melting Point	47-51 °C
Flash Point	119.1ºC
Purity	97%+
Density	1.03 g/cm³
Appearance	Solid
EC Number	222-448-8
Exact Mass	169.08900
Isomeric SMILES	CC1=CC(=NC=C1)C2=CC=CC=C2

Q&A

What is the molecular weight of 4-Methyl-2-phenylpyridine?

The molecular weight of 4-Methyl-2-phenylpyridine is 169.22.

What are the product categories that 4-Methyl-2-phenylpyridine belongs to?

4-Methyl-2-phenylpyridine belongs to API intermediates and Heterocycle-Pyridine series.

What are the synonyms for 4-Methyl-2-phenylpyridine?

The synonyms for 4-Methyl-2-phenylpyridine are 2-PHENYL-4-PICOLINE, 2-phenyl-4-methylpyridine, and Pyridine, 4-methyl-2-phenyl-.

What is the molecular formula of 4-Methyl-2-phenylpyridine?

The molecular formula of 4-Methyl-2-phenylpyridine is C12H11N.

What is the EINECS number of 4-Methyl-2-phenylpyridine?

The EINECS number of 4-Methyl-2-phenylpyridine is 222-448-8.

What is the melting point of 4-Methyl-2-phenylpyridine?

The melting point of 4-Methyl-2-phenylpyridine is in the range of 47.0 to 51.0 °C.

What is the density of 4-Methyl-2-phenylpyridine?

The predicted density of 4-Methyl-2-phenylpyridine is 1.030±0.06 g/cm3.

What form does 4-Methyl-2-phenylpyridine come in?

4-Methyl-2-phenylpyridine comes in the form of powder to lump.

What is the boiling point of 4-Methyl-2-phenylpyridine?

The boiling point of 4-Methyl-2-phenylpyridine is 115°C at 3mmHg (lit.).

How should 4-Methyl-2-phenylpyridine be stored?

4-Methyl-2-phenylpyridine should be stored in an inert atmosphere at room temperature.