4-Methyl-2,2'-bipyridine

Catalog Number	ACM56100197-1
CAS	56100-19-7
Structure
Synonyms	4-Methyl-2-Pyridin-2-Ylpyridine; 4-Methyl-2-(2-Pyridyl)Pyridine
IUPAC Name	4-methyl-2-pyridin-2-ylpyridine
Molecular Weight	170.21
Molecular Formula	C11H10N2
Canonical SMILES	CC1=CC(=NC=C1)C2=CC=CC=N2
InChI	OHSRAWAUPZWNKY-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H10N2/c1-9-5-7-13-11(8-9)10-4-2-3-6-12-10/h2-8H,1H3
Boiling Point	296.6ºC at 760 mmHg
Melting Point	62-64 °C
Flash Point	111.9ºC
Purity	97%+
Density	1.081g/cm³
Exact Mass	170.08400
Isomeric SMILES	CC1=CC(=NC=C1)C2=CC=CC=N2

Q&A

What is the molecular weight of 4-Methyl-2,2'-bipyridine?

The molecular weight of 4-Methyl-2,2'-bipyridine is 170.21.

What are the product categories that 4-Methyl-2,2'-bipyridine belongs to?

4-Methyl-2,2'-bipyridine belongs to the API intermediates product category.

What is the melting point of 4-Methyl-2,2'-bipyridine?

The melting point of 4-Methyl-2,2'-bipyridine is 62-64 °C.

What are some synonyms for 4-Methyl-2,2'-bipyridine?

Some synonyms for 4-Methyl-2,2'-bipyridine include 2,2'-bipyridine, 4-methyl-, 4-methyl-2-pyridin-2-ylpyridine, 4-Methyl-[2,2']bipyridinyl, 2-(4-methylpyridin-2-yl)pyridine, and 4-methyl-2,2'-dipyridyl.

What is the chemical formula of 4-Methyl-2,2'-bipyridine?

The chemical formula of 4-Methyl-2,2'-bipyridine is C11H10N2.

How should 4-Methyl-2,2'-bipyridine be stored?

4-Methyl-2,2'-bipyridine should be sealed in dry conditions at room temperature for storage.

What is the predicted density of 4-Methyl-2,2'-bipyridine?

The predicted density of 4-Methyl-2,2'-bipyridine is 1.081±0.06 g/cm3.

What is the predicted pKa value of 4-Methyl-2,2'-bipyridine?

The predicted pKa value of 4-Methyl-2,2'-bipyridine is 4.73±0.18.

What is the predicted boiling point of 4-Methyl-2,2'-bipyridine?

The predicted boiling point of 4-Methyl-2,2'-bipyridine is 296.6±25.0 °C.

What is the HS code for 4-Methyl-2,2'-bipyridine?

The HS code for 4-Methyl-2,2'-bipyridine is 9999999999.