4'-Methyl-2,2':6',2''-terpyridine

Catalog Number	ACM72036410-1
CAS	72036-41-0
Structure
Synonyms	2,2':6',2''-Terpyridine,4'-methyl-
IUPAC Name	4-methyl-2,6-dipyridin-2-ylpyridine
Molecular Weight	247.30
Molecular Formula	C16H13N3
InChI	UZUDKOHDONKQCH-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H13N3/c1-12-10-15(13-6-2-4-8-17-13)19-16(11-12)14-7-3-5-9-18-14/h2-11H,1H3
Purity	98%
Isomeric SMILES	CC1=CC(=NC(=C1)C2=CC=CC=N2)C3=CC=CC=N3

Q&A

What is the molecular weight of 4'-Methyl-2,2':6',2''-terpyridine?

The molecular weight of 4'-Methyl-2,2':6',2''-terpyridine is 247.29.

What is another name for 4'-Methyl-2,2':6',2''-terpyridine?

Another name for 4'-Methyl-2,2':6',2''-terpyridine is 2,2':6',2''-Terpyridine,4'-methyl-.

What is the chemical formula of 4'-Methyl-2,2':6',2''-terpyridine?

The chemical formula of 4'-Methyl-2,2':6',2''-terpyridine is C16H13N3.

What is the CAS number of 4'-Methyl-2,2':6',2''-terpyridine?

The CAS number of 4'-Methyl-2,2':6',2''-terpyridine is 72036-41-0.

What is the EINECS number of 4'-Methyl-2,2':6',2''-terpyridine?

The EINECS number of 4'-Methyl-2,2':6',2''-terpyridine is 201-212-8.

How many nitrogen atoms are in the chemical structure of 4'-Methyl-2,2':6',2''-terpyridine?

There are 3 nitrogen atoms in the chemical structure of 4'-Methyl-2,2':6',2''-terpyridine.

Are there any synonyms for 4'-Methyl-2,2':6',2''-terpyridine?

Yes, some synonyms for 4'-Methyl-2,2':6',2''-terpyridine are 4'-METHYL-2,2':6',2''-TERPYRIDINE and 4-methyl-2,6-dipyridin-2-ylpyridine.

What is the systematic name of 4'-Methyl-2,2':6',2''-terpyridine?

The systematic name of 4'-Methyl-2,2':6',2''-terpyridine is 4'-Methyl-2,2':6',2''-terpyridin.

What is the molecular formula of 4'-Methyl-2,2':6',2''-terpyridine?

The molecular formula of 4'-Methyl-2,2':6',2''-terpyridine is C16H13N3.

Is 4'-Methyl-2,2':6',2''-terpyridine a commonly used compound in research and industry?

4'-Methyl-2,2':6',2''-terpyridine is a chemical compound that is used in research and industry for various purposes.