4-Methyl-1,10-phenanthroline

Catalog Number	ACM31301287
CAS	31301-28-7
Structure
Synonyms	1,10-Phenanthroline, 4-Methyl-
IUPAC Name	4-methyl-1,10-phenanthroline
Molecular Weight	194.23
Molecular Formula	C13H10N2
InChI	NAZZKEZTSOOCSZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H10N2/c1-9-6-8-15-13-11(9)5-4-10-3-2-7-14-12(10)13/h2-8H,1H3
Melting Point	143-145 °C-lit
Purity	97%
Appearance	Brown powder
Isomeric SMILES	CC1=C2C=CC3=C(C2=NC=C1)N=CC=C3

Q&A

What is the chemical formula for 4-Methyl-1,10-phenanthroline?

The chemical formula for 4-Methyl-1,10-phenanthroline is C13H10N2.

What is the molecular weight of 4-Methyl-1,10-phenanthroline?

The molecular weight of 4-Methyl-1,10-phenanthroline is 194.23 g/mol.

What are some synonyms for 4-Methyl-1,10-phenanthroline?

Some synonyms for 4-Methyl-1,10-phenanthroline include 4-methyl-10-phenanthroline, TIMTEC-BB SBB009139, 4-Methyl Phenanthroline, 4-Methyl-1,10-phenanthroline 98%, and others.

What is the melting point of 4-Methyl-1,10-phenanthroline?

The melting point of 4-Methyl-1,10-phenanthroline is 143-145 °C.

Is 4-Methyl-1,10-phenanthroline soluble in water?

Yes, 4-Methyl-1,10-phenanthroline is soluble in water.

What is the general description of 4-Methyl-1,10-phenanthroline?

4-Methyl-1,10-phenanthroline is a methyl substituted phenanthroline commonly used as a ligand.

What is the storage temperature recommendation for 4-Methyl-1,10-phenanthroline?

The storage recommendation for 4-Methyl-1,10-phenanthroline is to keep it in a dark place, under an inert atmosphere, at room temperature.

What are the hazard codes associated with 4-Methyl-1,10-phenanthroline?

The hazard codes associated with 4-Methyl-1,10-phenanthroline are Xn and Xi.

What are some safety statements related to 4-Methyl-1,10-phenanthroline?

Some safety statements related to 4-Methyl-1,10-phenanthroline are 26 (In case of contact with eyes, rinse immediately with plenty of water and seek medical advice) and 36 (Wear suitable protective clothing).

What are some uses of 4-Methyl-1,10-phenanthroline?

One of the uses of 4-Methyl-1,10-phenanthroline is that it can be used to produce 1,10-Phenanthrolin-4-aldehyde.