4-Chloro-2,2'-bipyridine

Catalog Number	ACM14162948-1
CAS	14162-94-8
Structure
Synonyms	4-Chloro-2-Pyridin-2-Ylpyridine
IUPAC Name	4-chloro-2-pyridin-2-ylpyridine
Molecular Weight	190.63
Molecular Formula	C10H7N2Cl
InChI	IXEGJZGCPOORDR-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H7ClN2/c11-8-4-6-13-10(7-8)9-3-1-2-5-12-9/h1-7H
Boiling Point	309.768 °C at 760 mmHg
Melting Point	84-85 °C
Purity	95%+
Appearance	Solid
Isomeric SMILES	C1=CC=NC(=C1)C2=NC=CC(=C2)Cl

Q&A

What is the CAS number of 4-Chloro-2,2'-bipyridine?

The CAS number of 4-Chloro-2,2'-bipyridine is 14162-94-8.

What is the molecular weight of 4-Chloro-2,2'-bipyridine?

The molecular weight of 4-Chloro-2,2'-bipyridine is 190.63.

What are the synonyms of 4-Chloro-2,2'-bipyridine?

The synonyms of 4-Chloro-2,2'-bipyridine are 4-Chloro-2,2'-bipyridyl, 4-Chloro-2-(pyridin-2-yl)pyridine, 2,2'-Bipyridine, 4-chloro-.

What is the molecular formula of 4-Chloro-2,2'-bipyridine?

The molecular formula of 4-Chloro-2,2'-bipyridine is C10H7ClN2.

What is the melting point of 4-Chloro-2,2'-bipyridine?

The melting point of 4-Chloro-2,2'-bipyridine is 84-85℃.

What is the density of 4-Chloro-2,2'-bipyridine at 20 ºC and 760 Torr?

The density of 4-Chloro-2,2'-bipyridine is 1.245±0.06 g/cm3 at 20 ºC and 760 Torr.

What is the predicted pKa value of 4-Chloro-2,2'-bipyridine?

The predicted pKa value of 4-Chloro-2,2'-bipyridine is 3.72±0.22.

What is the predicted boiling point of 4-Chloro-2,2'-bipyridine?

The predicted boiling point of 4-Chloro-2,2'-bipyridine is 309.8±27.0 °C.

How should 4-Chloro-2,2'-bipyridine be stored?

4-Chloro-2,2'-bipyridine should be stored under inert gas (nitrogen or Argon) at 2-8°C.