4-Chloro-1,10-phenanthroline

Catalog Number	ACM1891141-1
CAS	1891-14-1
Structure
Synonyms	4-Chloro-1,10-diazaphenanthrene
IUPAC Name	4-chloro-1,10-phenanthroline
Molecular Weight	214.65
Molecular Formula	C12H7N2Cl
Canonical SMILES	C1=CC2=C(C3=NC=CC(=C3C=C2)Cl)N=C1
InChI	BAEVILLEIGDCDN-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H7ClN2/c13-10-5-7-15-12-9(10)4-3-8-2-1-6-14-11(8)12/h1-7H
Boiling Point	380.5 °C at 760 mmHg
Melting Point	180-230 °C
Flash Point	215.8ºC
Purity	95%+
Density	1.375 g/cm³
Exact Mass	214.03000
Isomeric SMILES	C1=CC2=C(C3=NC=CC(=C3C=C2)Cl)N=C1

Q&A

What is the CAS number for 4-Chloro-1,10-phenanthroline?

The CAS number for 4-Chloro-1,10-phenanthroline is 1891-14-1.

What is the molecular weight of 4-Chloro-1,10-phenanthroline?

The molecular weight of 4-Chloro-1,10-phenanthroline is 214.65.

In what product category does 4-Chloro-1,10-phenanthroline belong?

4-Chloro-1,10-phenanthroline belongs in the product category of Electronic Chemicals.

What are some synonyms for 4-Chloro-1,10-phenanthroline?

Some synonyms for 4-Chloro-1,10-phenanthroline are 4-Chloro-1,10-diazaphenanthrene and 1,10-Phenanthroline, 4-chloro-.

What is the molecular formula of 4-Chloro-1,10-phenanthroline?

The molecular formula of 4-Chloro-1,10-phenanthroline is C12H7ClN2.

What is the predicted melting point of 4-Chloro-1,10-phenanthroline?

The predicted melting point of 4-Chloro-1,10-phenanthroline is between 180-230℃.

What is the predicted density of 4-Chloro-1,10-phenanthroline?

The predicted density of 4-Chloro-1,10-phenanthroline is 1.375±0.06 g/cm3.

What is the predicted pka value of 4-Chloro-1,10-phenanthroline?

The predicted pKa value of 4-Chloro-1,10-phenanthroline is 4.11±0.10.

What is the predicted boiling point of 4-Chloro-1,10-phenanthroline?

The predicted boiling point of 4-Chloro-1,10-phenanthroline is 380.5±22.0 °C.

What is the recommended storage temperature for 4-Chloro-1,10-phenanthroline?

The recommended storage temperature for 4-Chloro-1,10-phenanthroline is 2-8°C.