4-Carboxy-2,2'-bipyridine

Catalog Number	ACM1748896-2
CAS	1748-89-6
Structure
Synonyms	[2,2'-Bipyridine]-4-Carboxylic Acid; 2-Pyridin-2-Ylpyridine-4-Carboxylic Acid
IUPAC Name	2-pyridin-2-ylpyridine-4-carboxylic acid
Molecular Weight	200.19
Molecular Formula	C11H8N2O2
InChI	FRYSEKUUHUUJPX-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H8N2O2/c14-11(15)8-4-6-13-10(7-8)9-3-1-2-5-12-9/h1-7H,(H,14,15)
Purity	95%+
Isomeric SMILES	C1=CC=NC(=C1)C2=NC=CC(=C2)C(=O)O

Q&A

What is the molecular weight of 4-Carboxy-2,2'-bipyridine?

The molecular weight of 4-Carboxy-2,2'-bipyridine is 200.19.

What are the product categories that 4-Carboxy-2,2'-bipyridine belongs to?

4-Carboxy-2,2'-bipyridine belongs to the product categories Carboxylic Acids and Pyridines.

What is another name for 4-Carboxy-2,2'-bipyridine?

Another name for 4-Carboxy-2,2'-bipyridine is 2,2'-bipyridine-4-carboxylic acid.

What are some synonyms for 4-Carboxy-2,2'-bipyridine?

Some synonyms for 4-Carboxy-2,2'-bipyridine are 2,2'-BIPYRIDYL-4-CARBOXYLIC ACID, 2,2'- linked pyridine -4- formic acid, and DK7721.

What is the chemical formula for 4-Carboxy-2,2'-bipyridine?

The chemical formula for 4-Carboxy-2,2'-bipyridine is C11H8N2O2.

How should 4-Carboxy-2,2'-bipyridine be stored?

4-Carboxy-2,2'-bipyridine should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What are the hazard codes associated with 4-Carboxy-2,2'-bipyridine?

The hazard codes associated with 4-Carboxy-2,2'-bipyridine are Xn.

What is the RIDADR for 4-Carboxy-2,2'-bipyridine?

The RIDADR for 4-Carboxy-2,2'-bipyridine is 2811.

What is the packing group for 4-Carboxy-2,2'-bipyridine?

The packing group for 4-Carboxy-2,2'-bipyridine is Ⅲ.

What are the risk statements associated with 4-Carboxy-2,2'-bipyridine?

The risk statements associated with 4-Carboxy-2,2'-bipyridine are 22.