What is the CAS number for [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The CAS number for [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is 14366-74-6.
What is the IUPAC name of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The IUPAC name of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is [4-(bromomethyl)phenyl]methyl-triphenylphosphanium;bromide.
How many heavy atoms are present in the molecular formula of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
There are 29 heavy atoms present in the molecular formula of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide.
What is the molecular weight of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The molecular weight of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is 526.2 g/mol.
What is the exact mass of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The exact mass of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is 525.98836.
How many rotatable bonds are present in the structure of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
There are 6 rotatable bonds present in the structure of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide.
What is the topological polar surface area of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The topological polar surface area of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is 0.
What is the Monoisotopic Mass of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The Monoisotopic Mass of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is 523.99041.
How many Covalently-Bonded Unit Count are present in [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
There are 2 Covalently-Bonded Unit Count present in [4-(Bromomethyl)benzyl]triphenylphosphonium bromide.
What is the Canonical SMILES of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide?
The Canonical SMILES of [4-(Bromomethyl)benzyl]triphenylphosphonium bromide is C1=CC=C(C=C1)[P+](CC2=CC=C(C=C2)CBr)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-].