ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

4-Bromo-1,10-phenanthroline

Catalog Number ACM7089670
CAS 7089-67-0
Synonyms 1,10-Phenanthrolin-4-Bromo-
IUPAC Name 4-bromo-1,10-phenanthroline
Molecular Weight 259.10
Molecular Formula C12H7BrN2
InChI WITRVHHXXZEEPD-UHFFFAOYSA-N
InChI Key InChI=1S/C12H7BrN2/c13-10-5-7-15-12-9(10)4-3-8-2-1-6-14-11(8)12/h1-7H
Purity 98%
Isomeric SMILES C1=CC2=C(C3=NC=CC(=C3C=C2)Br)N=C1
Q&A

What is the CAS number for 4-Bromo-1,10-phenanthroline?

The CAS number for 4-Bromo-1,10-phenanthroline is 7089-67-0.

What is the molecular weight of 4-Bromo-1,10-phenanthroline?

The molecular weight of 4-Bromo-1,10-phenanthroline is 259.1.

What is the product name of 4-Bromo-1,10-phenanthroline?

The product name of 4-Bromo-1,10-phenanthroline is 1,10-phenanthrolin-4-broMo-.

What are some synonyms for 4-Bromo-1,10-phenanthroline?

Some synonyms for 4-Bromo-1,10-phenanthroline are 1,10-phenanthrolin-4-broMo- and 1,10-Phenanthroline, 4-broMo-.

What is the molecular formula of 4-Bromo-1,10-phenanthroline?

The molecular formula of 4-Bromo-1,10-phenanthroline is C12H7BrN2.

How should 4-Bromo-1,10-phenanthroline be stored?

4-Bromo-1,10-phenanthroline should be stored under inert gas (nitrogen or Argon) at 2-8°C.

Why is it recommended to store 4-Bromo-1,10-phenanthroline under inert gas?

It is recommended to store 4-Bromo-1,10-phenanthroline under inert gas to prevent oxidation and degradation of the compound.

What are some common uses of 4-Bromo-1,10-phenanthroline?

4-Bromo-1,10-phenanthroline is commonly used in organic synthesis and as a ligand in coordination chemistry.

How does 4-Bromo-1,10-phenanthroline compare to other phenanthroline derivatives?

4-Bromo-1,10-phenanthroline is a unique derivative of phenanthroline due to the presence of a bromine atom at the 4-position.

Are there any specific precautions that need to be taken when handling 4-Bromo-1,10-phenanthroline?

When handling 4-Bromo-1,10-phenanthroline, it is important to wear appropriate personal protective equipment, work in a well-ventilated area, and avoid contact with skin or eyes.

Please kindly note that our products and services are for research use only.