4,7-Dimethyl-1,10-phenanthroline

Catalog Number	ACM3248053-1
CAS	3248-05-3
Structure
Synonyms	4,7-Dimethyl-o-phenanthroline
IUPAC Name	4,7-dimethyl-1,10-phenanthroline
Molecular Weight	208.26
Molecular Formula	C14H12N2
Canonical SMILES	CC1=C2C=CC3=C(C=CN=C3C2=NC=C1)C
InChI	JIVLDFFWTQYGSR-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H12N2/c1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h3-8H,1-2H3
Boiling Point	397.5 °C at 760 mmHg
Melting Point	193-195 °C-lit.
Purity	98%
Solubility	1.07e-04 M;
Appearance	Pale brown powder
Complexity	227
Covalently-Bonded Unit Count	1
EC Number	221-827-5
Exact Mass	208.100048391
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	208.100048391
Rotatable Bond Count	0
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 4,7-Dimethyl-1,10-phenanthroline?

The molecular weight of 4,7-Dimethyl-1,10-phenanthroline is 208.26.

What is the chemical formula of 4,7-Dimethyl-1,10-phenanthroline?

The chemical formula of 4,7-Dimethyl-1,10-phenanthroline is C14H12N2.

At what temperature does 4,7-Dimethyl-1,10-phenanthroline melt?

4,7-Dimethyl-1,10-phenanthroline melts at 193-195 °C.

In what kind of solvents is 4,7-Dimethyl-1,10-phenanthroline soluble?

4,7-Dimethyl-1,10-phenanthroline is soluble in benzene and alcohol. It is slightly soluble in water.

What is the color of 4,7-Dimethyl-1,10-phenanthroline?

The color of 4,7-Dimethyl-1,10-phenanthroline ranges from white to gray to brown.

What is the primary use of 4,7-Dimethyl-1,10-phenanthroline?

4,7-Dimethyl-1,10-phenanthroline acts as an intermediate in synthetic chemistry and dyestuff field. It is also used as an organic bidentate ligand and form complexes with metal for detection.

What is the Hazard Code associated with 4,7-Dimethyl-1,10-phenanthroline?

The Hazard Code associated with 4,7-Dimethyl-1,10-phenanthroline is Xn.

In which country is 4,7-Dimethyl-1,10-phenanthroline classified as WGK 3?

4,7-Dimethyl-1,10-phenanthroline is classified as WGK 3 in Germany.

What is the CAS number for 4,7-Dimethyl-1,10-phenanthroline?

The CAS number for 4,7-Dimethyl-1,10-phenanthroline is 3248-05-3.

How does 4,7-Dimethyl-1,10-phenanthroline play a role in coordination polymer and luminescence?

4,7-Dimethyl-1,10-phenanthroline forms complexes with metal for detection, and it plays an important role in coordination polymer and luminescence.