4,7-Dichloro-5-methyl-1,10-phenanthroline

Catalog Number	ACM503864026-2
CAS	503864-02-6
Structure
Synonyms	1,10-Phenanthroline, 4,7-dichloro-5-methyl-
IUPAC Name	4,7-dichloro-5-methyl-1,10-phenanthroline
Molecular Weight	263.12
Molecular Formula	C13H8Cl2N2
InChI	NOAAEEUNKLEBBN-UHFFFAOYSA-N
InChI Key	InChI=1S/C13H8Cl2N2/c1-7-6-8-9(14)2-4-16-12(8)13-11(7)10(15)3-5-17-13/h2-6H,1H3
Purity	98%
Isomeric SMILES	CC1=CC2=C(C=CN=C2C3=NC=CC(=C13)Cl)Cl

Q&A

What is the CAS number of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The CAS number is 503864-02-6.

What is the molecular weight of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The molecular weight is 263.12.

What are some synonyms for 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

Some synonyms include 4,7-Dichloro-5-Methyl-1,10-phenanthroline and 1,10-Phenanthroline, 4,7-dichloro-5-methyl-.

What is the molecular formula of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The molecular formula is C13H8Cl2N2.

What is the predicted boiling point of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The predicted boiling point is 409.4 ± 40.0 °C.

How should 4,7-Dichloro-5-Methyl-1,10-phenanthroline be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The predicted density is 1.427 ± 0.06 g/cm3.

What is the predicted pka value of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

The predicted pka value is 3.22 ± 0.10.

Why is it recommended to store 4,7-Dichloro-5-Methyl-1,10-phenanthroline under inert gas?

It is recommended to prevent oxidation and degradation of the compound.

What are some potential uses or applications of 4,7-Dichloro-5-Methyl-1,10-phenanthroline?

It can be used as a chemical intermediate or in research and development processes.