4,7-Dichloro-1,10-phenanthroline

Catalog Number	ACM5394230-1
CAS	5394-23-0
Structure
Synonyms	1,10-Phenanthroline,4,7-Dichloro
IUPAC Name	4,7-dichloro-1,10-phenanthroline
Molecular Weight	249.10
Molecular Formula	C12H6Cl2N2
Canonical SMILES	C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Cl)Cl;
InChI	GIEQBYJCGYHHSU-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H6Cl2N2/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H
Boiling Point	395.9 °C at 760 mmHg
Melting Point	243-247 °C
Purity	97%
Appearance	Solid
Complexity	235
Covalently-Bonded Unit Count	1
Exact Mass	247.991g/mol
Heavy Atom Count	16
Isomeric SMILES	C1=CC2=C(C=CN=C2C3=NC=CC(=C31)Cl)Cl
Monoisotopic Mass	247.991g/mol
Topological Polar Surface Area	25.8A^2

Q&A

What is the molecular weight of 4,7-Dichloro-1,10-phenanthroline?

The molecular weight of 4,7-Dichloro-1,10-phenanthroline is 249.1.

What are the product categories that 4,7-Dichloro-1,10-phenanthroline belongs to?

4,7-Dichloro-1,10-phenanthroline belongs to product categories such as Building Blocks, Catalysis and Inorganic Chemistry, and Halogenated Heterocycles.

What is the physical form and color of 4,7-Dichloro-1,10-phenanthroline?

4,7-Dichloro-1,10-phenanthroline is a solid with a white to tan color.

What is the boiling point of 4,7-Dichloro-1,10-phenanthroline?

The boiling point of 4,7-Dichloro-1,10-phenanthroline is predicted to be 395.9±37.0 °C.

How should 4,7-Dichloro-1,10-phenanthroline be stored?

4,7-Dichloro-1,10-phenanthroline should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted pka value of 4,7-Dichloro-1,10-phenanthroline?

The predicted pka value of 4,7-Dichloro-1,10-phenanthroline is 3.29±0.10.

What are the synonyms of 4,7-Dichloro-1,10-phenanthroline?

The synonyms of 4,7-Dichloro-1,10-phenanthroline include 4,7-Dichloro-o-phenanthroline, NSC 626, and 1,10-Phenanthroline,4,7-dichloro.

What are the safety statements associated with 4,7-Dichloro-1,10-phenanthroline?

The safety statements associated with 4,7-Dichloro-1,10-phenanthroline are 26 and 39.

What is the InChIKey of 4,7-Dichloro-1,10-phenanthroline?

The InChIKey of 4,7-Dichloro-1,10-phenanthroline is GIEQBYJCGYHHSU-UHFFFAOYSA-N.