4,7-Di(naphthalen-1-yl)-1,10-phenanthroline

Catalog Number	ACM1215007809
CAS	1215007-80-9
Structure
Synonyms	4,7-DiM-tolyl-1,10-phenanthroline
IUPAC Name	4,7-dinaphthalen-1-yl-1,10-phenanthroline
Molecular Weight	432.51
Molecular Formula	C32H20N2
InChI	LECYNBGOOARXEX-UHFFFAOYSA-N
InChI Key	InChI=1S/C32H20N2/c1-3-11-23-21(7-1)9-5-13-25(23)27-17-19-33-31-29(27)15-16-30-28(18-20-34-32(30)31)26-14-6-10-22-8-2-4-12-24(22)26/h1-20H
Purity	98%
Isomeric SMILES	C1=CC=C2C(=C1)C=CC=C2C3=C4C=CC5=C(C=CN=C5C4=NC=C3)C6=CC=CC7=CC=CC=C76

Q&A

What is the molecular weight of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The molecular weight is 432.51

What is another name for 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

It is also known as 4,7-DiM-tolyl-1,10-phenanthroline.

What is the chemical formula of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The chemical formula is C32H20N2.

What is the boiling point of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The predicted boiling point is 643.3±55.0 °C.

How should 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted density of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The predicted density is 1.261±0.06 g/cm3.

What is the predicted pka value of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The predicted pka value is 4.83±0.10.

What is the CAS number of 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline?

The CAS number is 1215007-80-9.

How should one handle 4,7-Di(naphthalen-1-yl)-1,10-phenanthroline to ensure its stability?

It should be handled under inert gas at low temperature to ensure stability.