4,6-Bis(4-phenyl-4,5-dihydrooxazol-2-yl)dibenzo[b,d]furan

Catalog Number	ACM229153008
CAS	229153-00-8
Synonyms	4-Phenyl-2-[6-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)dibenzofuran-4-yl]-4,5-dihydro-1,3-oxazole
IUPAC Name	4-phenyl-2-[6-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)dibenzofuran-4-yl]-4,5-dihydro-1,3-oxazole
Molecular Weight	458.51
Molecular Formula	C30H22N2O3
InChI	YNAUPJHAAOZVLV-UHFFFAOYSA-N
InChI Key	InChI=1S/C30H22N2O3/c1-3-9-19(10-4-1)25-17-33-29(31-25)23-15-7-13-21-22-14-8-16-24(28(22)35-27(21)23)30-32-26(18-34-30)20-11-5-2-6-12-20/h1-16,25-26H,17-18H2
Purity	98%
Isomeric SMILES	C1C(N=C(O1)C2=CC=CC3=C2OC4=C3C=CC=C4C5=NC(CO5)C6=CC=CC=C6)C7=CC=CC=C7

Q&A

What is the CAS number for the compound with the name Oxazole, 2,2'-(4,6-dibenzofurandiyl)bis[4,5-dihydro-4-phenyl-?

The CAS number is 229153-00-8.

What is the molecular weight of the compound?

The molecular weight is 458.51.

What is another name for the compound 4,6-Bis(4-phenyl-4,5-dihydrooxazol-2-yl)dibenzo[b,d]furan?

Another name is Oxazole, 2,2'-(4,6-dibenzofurandiyl)bis[4,5-dihydro-4-phenyl-.

What is the molecular formula of the compound?

The molecular formula is C30H22N2O3.

What is the predicted boiling point of the compound?

The predicted boiling point is 684.8±55.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value is 3.74±0.70.

What is the predicted density of the compound?

The predicted density is 1.33±0.1 g/cm3.