4'-(4-Pyridyl)-2,2':6',2''-terpyridine

Catalog Number	ACM112881513-2
CAS	112881-51-3
Synonyms	2,2':6',2''-Terpyridine, 4'-(4-pyridinyl)-
IUPAC Name	2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine
Molecular Weight	310.35
Molecular Formula	C20H14N4
Canonical SMILES	C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=NC=C4
InChI	DPPKPCLKZOLTMB-UHFFFAOYSA-N
InChI Key	InChI=1S/C20H14N4/c1-3-9-22-17(5-1)19-13-16(15-7-11-21-12-8-15)14-20(24-19)18-6-2-4-10-23-18/h1-14H
Boiling Point	482.5±40.0 °C(Predicted)
Melting Point	227.2-228.1ºC
Complexity	356
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	310.121846464
Formal Charge	0
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	310.121846464
Rotatable Bond Count	3
Topological Polar Surface Area	51.6 Ų

Q&A

What is the molecular weight of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The molecular weight is 310.35.

What are some synonyms of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

Some synonyms include 4'-(pyridin-4-yl)-2,2':6',2''-terpyridine, 2,6-dipyridin-2-yl-4-pyridin-4-ylpyridine, and DK7544.

What is the melting point of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The melting point is 227.2-228.1℃.

What is the density of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The predicted density is 1.202±0.06 g/cm3.

In what form does 4'-(4-Pyridyl)-2,2':6',2''-terpyridine exist?

It exists in the form of powder to crystal.

What is the color of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The color ranges from white to light yellow to light orange.

What is the predicted boiling point of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The predicted boiling point is 482.5±40.0 °C.

How should 4'-(4-Pyridyl)-2,2':6',2''-terpyridine be stored?

It should be sealed in dry, room temperature storage.

What is the predicted pka value of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

The predicted pka value is 4.20±0.29.

What is one of the potential uses of 4'-(4-Pyridyl)-2,2':6',2''-terpyridine?

It is a potential inhibitor of topoisomerase I and II.