ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

4,4'-Diphenyl-2,2'-bipyridine

Catalog Number ACM6153920
CAS 6153-92-0
Structure {[CurrentData.Name]}
Synonyms 4-Phenyl-2-(4-Phenylpyridin-2-Yl)Pyridine
IUPAC Name 4-phenyl-2-(4-phenylpyridin-2-yl)pyridine
Molecular Weight 308.38
Molecular Formula C22H16N2
InChI OXMSMRJQZMTIMT-UHFFFAOYSA-N
InChI Key InChI=1S/C22H16N2/c1-3-7-17(8-4-1)19-11-13-23-21(15-19)22-16-20(12-14-24-22)18-9-5-2-6-10-18/h1-16H
Melting Point 188-190 °C-lit.
Purity 98%
Isomeric SMILES C1=CC=C(C=C1)C2=CC(=NC=C2)C3=NC=CC(=C3)C4=CC=CC=C4
Q&A

What is the chemical formula for 4,4'-Diphenyl-2,2'-bipyridine?

The chemical formula for 4,4'-Diphenyl-2,2'-bipyridine is C22H16N2.

What is the molecular weight of 4,4'-Diphenyl-2,2'-bipyridine?

The molecular weight of 4,4'-Diphenyl-2,2'-bipyridine is 308.38 g/mol.

What are some synonyms for 4,4'-Diphenyl-2,2'-bipyridine?

Some synonyms for 4,4'-Diphenyl-2,2'-bipyridine include 4,4'-diphenyl-2'-bipyridine and 4,4'-DIPHENYL-2,2'-BIPYRIDINE.

What is the melting point of 4,4'-Diphenyl-2,2'-bipyridine?

The melting point of 4,4'-Diphenyl-2,2'-bipyridine is 188-190 °C.

How is 4,4'-Diphenyl-2,2'-bipyridine stored?

4,4'-Diphenyl-2,2'-bipyridine is stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the predicted boiling point of 4,4'-Diphenyl-2,2'-bipyridine?

The predicted boiling point of 4,4'-Diphenyl-2,2'-bipyridine is 475.2±40.0 °C.

In what form does 4,4'-Diphenyl-2,2'-bipyridine exist?

4,4'-Diphenyl-2,2'-bipyridine exists in solid form.

What is the hazard code associated with 4,4'-Diphenyl-2,2'-bipyridine?

The hazard code associated with 4,4'-Diphenyl-2,2'-bipyridine is Xi.

What safety statements are associated with 4,4'-Diphenyl-2,2'-bipyridine?

The safety statements associated with 4,4'-Diphenyl-2,2'-bipyridine are 26-37/39.

Which country assigns a WGK of 3 to 4,4'-Diphenyl-2,2'-bipyridine?

Germany assigns a WGK of 3 to 4,4'-Diphenyl-2,2'-bipyridine.

Please kindly note that our products and services are for research use only.