4,4'-Dioctyl-2,2'-bipyridine

Catalog Number	ACM71879248
CAS	71879-24-8
Synonyms	4,4'-Di-N-Octyl-2,2'-Bipyridyl; 4-Octyl-2-(4-Octylpyridin-2-Yl)Pyridine
IUPAC Name	4-octyl-2-(4-octylpyridin-2-yl)pyridine
Molecular Weight	380.60
Molecular Formula	C26H40N2
InChI	VXCLQNZGEKCIKR-UHFFFAOYSA-N
InChI Key	InChI=1S/C26H40N2/c1-3-5-7-9-11-13-15-23-17-19-27-25(21-23)26-22-24(18-20-28-26)16-14-12-10-8-6-4-2/h17-22H,3-16H2,1-2H3
Purity	98%
Isomeric SMILES	CCCCCCCCC1=CC(=NC=C1)C2=NC=CC(=C2)CCCCCCCC

Q&A

What is the chemical formula for 4,4'-Dioctyl-2,2'-bipyridine?

The chemical formula is C44H76N2.

What is the molecular weight of 4,4'-Dioctyl-2,2'-bipyridine?

The molecular weight is 633.09.

What is the boiling point of 4,4'-Dioctyl-2,2'-bipyridine?

The boiling point is predicted to be 698.0±55.0 °C.

How should 4,4'-Dioctyl-2,2'-bipyridine be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the density of 4,4'-Dioctyl-2,2'-bipyridine?

The density is 0.899.

What is the predicted pKa value of 4,4'-Dioctyl-2,2'-bipyridine?

The predicted pKa value is 5.27±0.50.

Can 4,4'-Dioctyl-2,2'-bipyridine be referred to as 4-heptadecan-9-yl-2-(4-heptadecan-9-ylpyridin-2-yl)pyridine?

Yes, it can be referred to by that name as a synonym.

What are some other synonyms for 4,4'-Dioctyl-2,2'-bipyridine?

Some other synonyms include 4,4'-BIS(1-OCTYLNONYL)- 2,2'-BIPYRIDINE and 4,4'-Di(heptadecan-9-yl)-2,2'-bipyridine.

What is the CAS number for 4,4'-Dioctyl-2,2'-bipyridine?

The CAS number is 258262-75-8.

How is 4,4'-Dioctyl-2,2'-bipyridine also known as in the chemical industry?

It is also known as 4,4'-Bis(1-octylnonyl)-2,2'-bipyridine in the chemical industry.