4,4'-Dinonyl-2,2'-bipyridine

Catalog Number	ACM142646580-3
CAS	142646-58-0
Structure
Synonyms	4-Nonyl-2-(4-nonylpyridin-2-yl)pyridine; 2,2'-Bipyridine, 4,4'-dinonyl-
IUPAC Name	4-nonyl-2-(4-nonylpyridin-2-yl)pyridine
Molecular Weight	408.66
Molecular Formula	C28H44N2
Canonical SMILES	CCCCCCCCCC1=CC(=NC=C1)C2=NC=CC(=C2)CCCCCCCCC
InChI	VHJFWJXYEWHCGD-UHFFFAOYSA-N
InChI Key	InChI=1S/C28H44N2/c1-3-5-7-9-11-13-15-17-25-19-21-29-27(23-25)28-24-26(20-22-30-28)18-16-14-12-10-8-6-4-2/h19-24H,3-18H2,1-2H3
Boiling Point	522.4±45.0 °C(Predicted)
Melting Point	61-63 °C-lit.
Exact Mass	408.350449412
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	408.350449412
Rotatable Bond Count	17
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 4,4'-Dinonyl-2,2'-bipyridine?

The molecular weight of 4,4'-Dinonyl-2,2'-bipyridine is 408.66.

What is the product category of 4,4'-Dinonyl-2,2'-bipyridine?

The product categories of 4,4'-Dinonyl-2,2'-bipyridine are C9 to C46, Heterocyclic Building Blocks, and Pyridines.

What is the color of 4,4'-Dinonyl-2,2'-bipyridine?

The color of 4,4'-Dinonyl-2,2'-bipyridine is White to Almost white.

What is the CAS number of 4,4'-Dinonyl-2,2'-bipyridine?

The CAS number of 4,4'-Dinonyl-2,2'-bipyridine is 142646-58-0.

What is the boiling point of 4,4'-Dinonyl-2,2'-bipyridine?

The boiling point of 4,4'-Dinonyl-2,2'-bipyridine is predicted to be 522.4±45.0 °C.

What are the synonyms of 4,4'-Dinonyl-2,2'-bipyridine?

The synonyms of 4,4'-Dinonyl-2,2'-bipyridine are 4,4'-DI-NONYL-2,2'-BIPYRIDINE, 98%, 4,4'-BIS(NONYL)-2,2'-BIPYRIDINE, and more.

What is the storage recommendation for 4,4'-Dinonyl-2,2'-bipyridine?

It is recommended to store 4,4'-Dinonyl-2,2'-bipyridine sealed in dry at room temperature.

How is 4,4'-Dinonyl-2,2'-bipyridine used?

4,4'-Dinonyl-2,2'-bipyridine is used in the preparation of an artificial muscle with a lamellar structure and as a complex in cyclic voltammetric studies of copper complexes catalyzing atom transfer radical polymerization.

What is the pKa value of 4,4'-Dinonyl-2,2'-bipyridine?

The pKa value of 4,4'-Dinonyl-2,2'-bipyridine is predicted to be 5.30±0.30.

What are the hazard and safety statements associated with 4,4'-Dinonyl-2,2'-bipyridine?

The hazard code is Xi, and the safety statements are 26-36.