ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole

Catalog Number ACM383185748
CAS 383185-74-8
Structure {[CurrentData.Name]}
Synonyms 4,4-Dimethyl-2-[4-(4-methylphenyl)phenyl]-5H-1,3-oxazole
IUPAC Name 4,4-dimethyl-2-[4-(4-methylphenyl)phenyl]-5H-1,3-oxazole
Molecular Weight 265.35
Molecular Formula C18H19NO
InChI LYTJWPZPRXOKNY-UHFFFAOYSA-N
InChI Key InChI=1S/C18H19NO/c1-13-4-6-14(7-5-13)15-8-10-16(11-9-15)17-19-18(2,3)12-20-17/h4-11H,12H2,1-3H3
Purity 98%
Isomeric SMILES CC1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(CO3)(C)C
Q&A

What is the chemical formula of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The chemical formula is C18H19NO.

What is the molecular weight of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The molecular weight is 265.35.

What is the CAS number for 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The CAS number is 383185-74-8.

What is the boiling point of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The predicted boiling point is 393.5±21.0 °C.

What is the pKa value of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The predicted pKa value is 4.94±0.70.

What is the predicted density of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The predicted density is 1.05±0.1 g/cm3.

What are some synonyms for 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

Some synonyms are Oxazole, 4,5-dihydro-4,4-dimethyl-2-(4'-methyl[1,1'-biphenyl]-4-yl)- and 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole.

What is the structure of 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The structure consists of a oxazole ring with two methyl groups and a biphenyl group attached.

How is 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole predicted to behave in terms of acidity?

It is predicted to have a pKa value of 4.94±0.70, indicating it is a weak acid.

What is the predicted boiling point range for 4,4-Dimethyl-2-(4'-methyl-[1,1'-biphenyl]-4-yl)-4,5-dihydrooxazole?

The predicted boiling point range is 393.5±21.0 °C.

Please kindly note that our products and services are for research use only.