4,4'-Dimethyl-2,2'-bipyridyl

Catalog Number	ACM1134356-1
CAS	1134-35-6
Structure
Synonyms	4,4'-Dimethyl-2,2'-bipyridine; 4,4'-Dimethyl-2,2'-dipyridyl
IUPAC Name	4-methyl-2-(4-methylpyridin-2-yl)pyridine
Molecular Weight	184.24
Molecular Formula	C12H12N2
Canonical SMILES	CC1=CC(=NC=C1)C2=NC=CC(=C2)C
InChI	NBPGPQJFYXNFKN-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H12N2/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12/h3-8H,1-2H3
Melting Point	169-174 °C-lit.
Appearance	Beige powder
Complexity	161
Covalently-Bonded Unit Count	1
EC Number	214-483-2
Exact Mass	184.100048391
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	184.100048391
Rotatable Bond Count	1
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of 4,4'-Dimethyl-2,2'-bipyridyl?

The molecular weight of 4,4'-Dimethyl-2,2'-bipyridyl is 184.24.

What are the synonyms for 4,4'-Dimethyl-2,2'-bipyridyl?

The synonyms for 4,4'-Dimethyl-2,2'-bipyridyl include 2,2'-Bipyridyl, 4,4'-dimethyl- and 2'-Bipyridine,4,4'-dimethyl-2.

What is the Melting point of 4,4'-Dimethyl-2,2'-bipyridyl?

The Melting point of 4,4'-Dimethyl-2,2'-bipyridyl is 169-174 °C (lit.).

In what form does 4,4'-Dimethyl-2,2'-bipyridyl exist?

4,4'-Dimethyl-2,2'-bipyridyl exists in Crystalline Powder form.

What is the solubility of 4,4'-Dimethyl-2,2'-bipyridyl in Chloroform?

4,4'-Dimethyl-2,2'-bipyridyl is slightly soluble in Chloroform.

What are the Hazard Codes associated with 4,4'-Dimethyl-2,2'-bipyridyl?

The Hazard Codes associated with 4,4'-Dimethyl-2,2'-bipyridyl are Xi,Xn.

What are the Safety Statements for handling 4,4'-Dimethyl-2,2'-bipyridyl?

The Safety Statements for handling 4,4'-Dimethyl-2,2'-bipyridyl are 26-36-37/39.

What is the Toxicity of 4,4'-Dimethyl-2,2'-bipyridyl in mice?

The LD50 toxicity of 4,4'-Dimethyl-2,2'-bipyridyl in mice intraperitoneally is 78.7mg/kg.

What are the uses of 4,4'-Dimethyl-2,2'-bipyridyl?

4,4'-Dimethyl-2,2'-bipyridyl is used as a chemical Intermediate, and it can be used for the determination of ferrous and cyanide compounds.

How can 4,4'-Dimethyl-2,2'-bipyridyl be purified?

4,4'-Dimethyl-2,2'-bipyridyl can be crystallized from ethyl acetate for purification.