4,4'-Diiodo-2,2'-bipyridine

Catalog Number	ACM831225811
CAS	831225-81-1
Structure
Synonyms	4-Iodo-2-(4-iodopyridin-2-yl)pyridine
IUPAC Name	4-iodo-2-(4-iodopyridin-2-yl)pyridine
Molecular Weight	407.98
Molecular Formula	C10H6N2I2
InChI	WWWDYUQYODBAIL-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H6I2N2/c11-7-1-3-13-9(5-7)10-6-8(12)2-4-14-10/h1-6H
Purity	98%
Isomeric SMILES	C1=CN=C(C=C1I)C2=NC=CC(=C2)I

Q&A

What is the CAS number for 4,4'-Diiodo-2,2'-bipyridine?

The CAS number for 4,4'-Diiodo-2,2'-bipyridine is 831225-81-1.

What is the molecular weight of 4,4'-Diiodo-2,2'-bipyridine?

The molecular weight of 4,4'-Diiodo-2,2'-bipyridine is 407.98.

What is the product name of 4,4'-Diiodo-2,2'-bipyridine?

The product name of 4,4'-Diiodo-2,2'-bipyridine is also 4,4'-DIIODO-2,2'-BIPYRIDINE.

What are the synonyms for 4,4'-Diiodo-2,2'-bipyridine?

The synonyms for 4,4'-Diiodo-2,2'-bipyridine are 4,4'-DIIODO-2,2'-BIPYRIDINE and 2,2'-Bipyridine, 4,4'-diiodo-.

What is the molecular formula of 4,4'-Diiodo-2,2'-bipyridine?

The molecular formula of 4,4'-Diiodo-2,2'-bipyridine is C10H6I2N2.

What is the predicted boiling point of 4,4'-Diiodo-2,2'-bipyridine?

The predicted boiling point of 4,4'-Diiodo-2,2'-bipyridine is 445.2±45.0 °C.

What is the predicted pKa value of 4,4'-Diiodo-2,2'-bipyridine?

The predicted pKa value of 4,4'-Diiodo-2,2'-bipyridine is 2?+-0.30.

What is the predicted density of 4,4'-Diiodo-2,2'-bipyridine?

The predicted density of 4,4'-Diiodo-2,2'-bipyridine is 2.201±0.06 g/cm3.

How many iodine atoms are present in the structure of 4,4'-Diiodo-2,2'-bipyridine?

There are two iodine atoms present in the structure of 4,4'-Diiodo-2,2'-bipyridine.