[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride

Catalog Number	ACM1034901502-1
CAS	1034901-50-2
Synonyms	[4,4 Inverted exclamation marka-bis(1,1-dimethylethyl)-2,2 inverted exclamation marka-bipyridine] nickel (II) dichloride
Molecular Weight	398
Molecular Formula	C18H24Cl2N2Ni
Canonical SMILES	CC(C)(C)C1=CC(=NC=C1)C2=NC=CC(=C2)C(C)(C)C.Cl[Ni]Cl
InChI	InChI=1S/C18H24N2.2ClH.Ni/c1-17(2,3)13-7-9-19-15(11-13)16-12-14(8-10-20-16)18(4,5)6;/h7-12H,1-6H3;2*1H;/q;+2/p-2
InChI Key	PCWIKFRTCXESOT-UHFFFAOYSA-L
Melting Point	300+ °C
Purity	97%
Complexity	281
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	396.066996
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	396.066996
Rotatable Bond Count	3
Topological Polar Surface Area	25.8 Ų

Q&A

What is the molecular weight of [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride?

The molecular weight is 398.

What are some synonyms for [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride?

Some synonyms include Dichloro(4,4'-di-tert-butyl-2,2'-bipyridine)nickel, SKL621, and (4, 4 dtbbpy) NiCl2.

What is the chemical formula of [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride?

The chemical formula is C18H24Cl2N2Ni.

What is the melting point of [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride?

The melting point is greater than 300°C.

How should [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What are some uses of [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride as a catalyst?

It can be used in the decarboxylative arylation of oxo acids, acylation of ethers, and cross-coupling of aryl bromides with alcohols.

How can [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride be used in decarboxylative arylation?

It can act as a catalyst in decarboxylative arylation of oxo acids.

What type of compounds can [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride acylate?

It can acylate ethers.

What reaction can [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride facilitate in the cross-coupling process?

It can facilitate the cross-coupling of aryl bromides with alcohols.

How does [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride benefit chemical reactions?

It acts as a catalyst to facilitate various chemical reactions such as decarboxylative arylation, acylation, and cross-coupling reactions.