4,4',6,6'-Tetramethyl-2,2'-bipyridine

Catalog Number	ACM4444273-1
CAS	4444-27-3
Structure
Synonyms	6,6'-Bi-2,4-Lutidine; 2-(4,6-dimethylpyridin-2-yl)-4,6-dimethylpyridine
IUPAC Name	2-(4,6-dimethylpyridin-2-yl)-4,6-dimethylpyridine
Molecular Weight	212.29
Molecular Formula	C14H16N2
InChI	SMLORZJGJAWILX-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H16N2/c1-9-5-11(3)15-13(7-9)14-8-10(2)6-12(4)16-14/h5-8H,1-4H3
Boiling Point	307.4 °C at 760 mmHg
Melting Point	142.5-143 °C
Flash Point	116.1ºC
Purity	98%
Density	1.029g/cm³
Exact Mass	212.13100
Isomeric SMILES	CC1=CC(=NC(=C1)C2=CC(=CC(=N2)C)C)C

Q&A

What is the CAS number for 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

The CAS number for 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 4444-27-3.

What is the molecular weight of 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

The molecular weight of 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 212.29 g/mol.

What are some synonyms for 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

Some synonyms for 4,4',6,6'-Tetramethyl-2,2'-bipyridine are 2-(4,6-dimethylpyridin-2-yl)-4,6-dimethylpyridine and 2,2'-Bipyridine, 4,4',6,6'-tetramethyl-.

What is the molecular formula of 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

The molecular formula of 4,4',6,6'-Tetramethyl-2,2'-bipyridine is C14H16N2.

At what temperature does 4,4',6,6'-Tetramethyl-2,2'-bipyridine melt?

4,4',6,6'-Tetramethyl-2,2'-bipyridine melts at a temperature range of 142.5-143.0 °C (Solv: ligroine).

What is the density of 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

The predicted density of 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 1.029±0.06 g/cm3.

At what temperature is the boiling point of 4,4',6,6'-Tetramethyl-2,2'-bipyridine predicted to be?

The predicted boiling point of 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 307.4±37.0 °C.

What is the predicted pKa value of 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

The predicted pKa value of 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 5.90±0.42.

How many methyl groups are present in 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

4,4',6,6'-Tetramethyl-2,2'-bipyridine contains four methyl groups.

What is the another compound with a similar molecular formula to 4,4',6,6'-Tetramethyl-2,2'-bipyridine?

One compound with a similar molecular formula to 4,4',6,6'-Tetramethyl-2,2'-bipyridine is 2,2'-bipyridine, 1,1'-dimethyl-.