4,4',4''-Trimethyl-2,2':6',2''-terpyridine

Catalog Number	ACM33354755-1
CAS	33354-75-5
Structure
Synonyms	4-Methyl-2,6-bis(4-methylpyridin-2-yl)pyridine
IUPAC Name	4-methyl-2,6-bis(4-methylpyridin-2-yl)pyridine
Molecular Weight	275.35
Molecular Formula	C18H17N3
InChI	VEOPFEPGENIUIA-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H17N3/c1-12-4-6-19-15(8-12)17-10-14(3)11-18(21-17)16-9-13(2)5-7-20-16/h4-11H,1-3H3
Boiling Point	422.5 °C at 760 mmHg
Purity	98%
Isomeric SMILES	CC1=CC(=NC=C1)C2=CC(=CC(=N2)C3=NC=CC(=C3)C)C

Q&A

What is the chemical formula of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The chemical formula is C18H17N3.

What is the molecular weight of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The molecular weight is 275.35 g/mol.

What are the synonyms for 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

Some synonyms include 2,2':6',2''-Ter-4-picoline and 2,6-Bis(4-methyl-2-pyridyl)-4-methylpyridine.

What is the boiling point of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The boiling point is predicted to be 422.5±40.0 °C.

What is the pKa value of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The pKa value is predicted to be 5.51±0.42.

What is the color of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The color is white to off-white.

What is the predicted density of 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The predicted density is 1.108±0.06 g/cm3.

In what form is 4',4,4''-trimethyl-2,2':6',2''-terpyridine typically found?

It is found in powder form.

What is the CAS number for 4',4,4''-trimethyl-2,2':6',2''-terpyridine?

The CAS number is 33354-75-5.