4,4',4''-Triethyl-2,2':6',2''-terpyridine

Catalog Number	ACM33354777
CAS	33354-77-7
Synonyms	4-Ethyl-2,6-bis(4-ethylpyridin-2-yl)pyridine
IUPAC Name	4-ethyl-2,6-bis(4-ethylpyridin-2-yl)pyridine
Molecular Weight	317.43
Molecular Formula	C21H23N3
InChI	YOWBQVKUBSRDEP-UHFFFAOYSA-N
InChI Key	InChI=1S/C21H23N3/c1-4-15-7-9-22-18(11-15)20-13-17(6-3)14-21(24-20)19-12-16(5-2)8-10-23-19/h7-14H,4-6H2,1-3H3
Purity	98%
Isomeric SMILES	CCC1=CC(=NC=C1)C2=CC(=CC(=N2)C3=NC=CC(=C3)CC)CC

Q&A

What is the chemical formula for 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The chemical formula is C21H23N3.

What is the molecular weight of 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The molecular weight is 317.43.

What is the boiling point of 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The boiling point is predicted to be 455.1±40.0 °C.

What is the predicted pka value of 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The predicted pka value is 5.70±0.42.

What is the predicted density of 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The predicted density is 1.064±0.06 g/cm3.

What are some synonyms for 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

Some synonyms include 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE and 2,2':6',2''-Terpyridine, 4,4',4''-triethyl-.

What is the CAS number for 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

The CAS number is 33354-77-7.

How many ethyl groups are present in 4,4,4-TRIETHYL-2,2:6,2-TERPYRIDINE?

There are three ethyl groups present.