4,4'-([2,2'-Bipyridine]-4,4'-diyl)dibenzoic acid

Catalog Number	ACM143954727-1
CAS	143954-72-7
Synonyms	4-[2-[4-(4-Carboxyphenyl)pyridin-2-Yl]pyridin-4-Yl]benzoic acid
IUPAC Name	4-[2-[4-(4-carboxyphenyl)pyridin-2-yl]pyridin-4-yl]benzoic acid
Molecular Weight	396.40
Molecular Formula	C24H16N2O4
InChI	VUDNLKPOONKNTD-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H16N2O4/c27-23(28)17-5-1-15(2-6-17)19-9-11-25-21(13-19)22-14-20(10-12-26-22)16-3-7-18(8-4-16)24(29)30/h1-14H,(H,27,28)(H,29,30)
Purity	98%
Appearance	White solid
Isomeric SMILES	C1=CC(=CC=C1C2=CC(=NC=C2)C3=NC=CC(=C3)C4=CC=C(C=C4)C(=O)O)C(=O)O

Q&A

What is the molecular weight of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The molecular weight is 396.39.

What are some synonyms for 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

Some synonyms include Benzoic acid, 4,4'-([2,2'-bipyridine]-4,4'-diyl)bis- and 4,4'-bis(p-carboxyphenyl)-2,2'-bipyridine.

How many nitrogen atoms are present in the molecular formula of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

There are 2 nitrogen atoms present in the molecular formula.

What is the molecular formula of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The molecular formula is C24H16N2O4.

What is the predicted boiling point of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The predicted boiling point is 642.8±55.0 °C.

What is the predicted pka value of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The predicted pka value is 3.57±0.10.

What is the predicted density of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The predicted density is 1.335±0.06 g/cm3.

What is the CAS number of 4,4'-(2,2'-Bipyridine-4,4'-diyl)dibenzoic acid?

The CAS number is 143954-72-7.