4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine

Catalog Number	ACM144780858
CAS	144780-85-8
Synonyms	2,6-Dipyridin-2-yl-4-(3,4,5-trimethoxyphenyl)pyridine
IUPAC Name	2,6-dipyridin-2-yl-4-(3,4,5-trimethoxyphenyl)pyridine
Molecular Weight	399.44
Molecular Formula	C24H21N3O3
InChI	ZDTPHJQUPFPBBL-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H21N3O3/c1-28-22-14-17(15-23(29-2)24(22)30-3)16-12-20(18-8-4-6-10-25-18)27-21(13-16)19-9-5-7-11-26-19/h4-15H,1-3H3
Purity	98%
Isomeric SMILES	COC1=CC(=CC(=C1OC)OC)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4

Q&A

What is the CAS number of 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The CAS number is 144780-85-8.

What is the molecular weight of 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The molecular weight is 399.44.

What is the product name of the compound?

The product name is 2,6-Dipyridin-2-yl-4-(3,4,5-trimethoxyphenyl)pyridine.

What are the synonyms for 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The synonyms are 2,6-Dipyridin-2-yl-4-(3,4,5-trimethoxyphenyl)pyridine and 2,2':6',2''-Terpyridine, 4'-(3,4,5-trimethoxyphenyl)-.

What is the molecular formula of the compound?

The molecular formula is C24H21N3O3.

What is the melting point of 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The melting point is 187-188 °C (Solv: ethanol).

What is the predicted density of the compound?

The predicted density is 1.185±0.06 g/cm3.

What is the predicted boiling point of 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The predicted boiling point is 531.9±50.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value is 4.48±0.29.

What is the structure of 4'-(3,4,5-Trimethoxyphenyl)-2,2':6',2''-terpyridine?

The structure consists of a terpyridine core with a 3,4,5-trimethoxyphenyl group attached at the 4' position.