4-((2,6-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)pyridin-4-yl)oxy)butan-1-ol

Catalog Number	ACM1254959959
CAS	1254959-95-9
Synonyms	4-[2,6-Bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyridin-4-yl]oxybutan-1-ol
IUPAC Name	4-[2,6-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyridin-4-yl]oxybutan-1-ol
Molecular Weight	361.44
Molecular Formula	C19H27N3O4
InChI	UNJJMHQCGTYQAD-UHFFFAOYSA-N
InChI Key	InChI=1S/C19H27N3O4/c1-18(2)11-25-16(21-18)14-9-13(24-8-6-5-7-23)10-15(20-14)17-22-19(3,4)12-26-17/h9-10,23H,5-8,11-12H2,1-4H3
Purity	98%
Isomeric SMILES	CC1(COC(=N1)C2=CC(=CC(=N2)C3=NC(CO3)(C)C)OCCCCO)C

Q&A

What is the CAS number for the compound?

The CAS number is 1254959-95-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 361.44.

What is the product name of the compound?

The product name is 1-Butanol, 4-[[2,6-bis(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-4-pyridinyl]oxy]-

What are the synonyms of the compound?

The synonyms are 1-Butanol, 4-[[2,6-bis(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-4-pyridinyl]oxy]- and 4-((2,6-Bis(4,4-dimethyl-4,5-dihydrooxazol-2-yl)pyridin-4-yl)oxy)butan-1-ol.

What is the molecular formula of the compound?

The molecular formula is C19H27N3O4.

What is the melting point range of the compound?

The melting point is 128-129 °C.

What is the predicted density of the compound?

The predicted density is 1.24±0.1 g/cm3.

What is the predicted boiling point of the compound?

The predicted boiling point is 547.3±50.0 °C.

What is the predicted pKa value of the compound?

The predicted pKa value is 14.99±0.10.