ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

3-Methyl-2,2'-bipyridine

Catalog Number ACM64859478
CAS 64859-47-8
Synonyms 3-Methyl-2-pyridin-2-ylpyridine
IUPAC Name 3-methyl-2-pyridin-2-ylpyridine
Molecular Weight 170.21
Molecular Formula C11H10N2
InChI TWIHWYXRPSNKHJ-UHFFFAOYSA-N
InChI Key InChI=1S/C11H10N2/c1-9-5-4-8-13-11(9)10-6-2-3-7-12-10/h2-8H,1H3
Purity 97%
Isomeric SMILES CC1=C(N=CC=C1)C2=CC=CC=N2
Q&A

What is the molecular weight of 3-Methyl-2,2'-bipyridine?

The molecular weight of 3-Methyl-2,2'-bipyridine is 170.21.

What are some synonyms for 3-Methyl-2,2'-bipyridine?

Some synonyms for 3-Methyl-2,2'-bipyridine are 3-Methyl-[2,2']bipyridinyl and 2,2'-Bipyridine, 3-methyl-.

What is the molecular formula of 3-Methyl-2,2'-bipyridine?

The molecular formula of 3-Methyl-2,2'-bipyridine is C11H10N2.

What is the boiling point of 3-Methyl-2,2'-bipyridine predicted to be?

The predicted boiling point of 3-Methyl-2,2'-bipyridine is 282.1±25.0 °C.

What is the pka value of 3-Methyl-2,2'-bipyridine predicted to be?

The predicted pka value of 3-Methyl-2,2'-bipyridine is 4.39±0.20.

What is the predicted density of 3-Methyl-2,2'-bipyridine?

The predicted density of 3-Methyl-2,2'-bipyridine is 1.081±0.06 g/cm3.

What is the CAS number for 3-Methyl-2,2'-bipyridine?

The CAS number for 3-Methyl-2,2'-bipyridine is 10273-88-8.

How does the predicted boiling point of 3-Methyl-2,2'-bipyridine compare to the actual boiling point?

The predicted boiling point may vary from the actual boiling point depending on various factors.

Why is 3-Methyl-2,2'-bipyridine commonly used in research or industry?

3-Methyl-2,2'-bipyridine is commonly used in research or industry due to its chemical properties and potential applications.

Are there any safety considerations or precautions to take when handling 3-Methyl-2,2'-bipyridine?

It is important to follow proper safety guidelines and protocols when handling 3-Methyl-2,2'-bipyridine, as with any chemical substance.

Please kindly note that our products and services are for research use only.