3-Iodo-2,2'-bipyridine

Catalog Number	ACM184345322
CAS	184345-32-2
Synonyms	3-Iodo-2-Pyridin-2-Ylpyridine
IUPAC Name	3-iodo-2-pyridin-2-ylpyridine
Molecular Weight	282.08
Molecular Formula	C10H7IN2
InChI	UZGKNZVDORMLMN-UHFFFAOYSA-N
InChI Key	InChI=1S/C10H7IN2/c11-8-4-3-7-13-10(8)9-5-1-2-6-12-9/h1-7H
Purity	97%
Isomeric SMILES	C1=CC=NC(=C1)C2=C(C=CC=N2)I

Q&A

What is the molecular weight of 3-Iodo-2,2'-bipyridine?

The molecular weight of 3-Iodo-2,2'-bipyridine is 282.08.

What is the CAS number of 3-Iodo-2,2'-bipyridine?

The CAS number of 3-Iodo-2,2'-bipyridine is 184345-32-2.

What are the synonyms of 3-Iodo-2,2'-bipyridine?

The synonyms of 3-Iodo-2,2'-bipyridine are 2,2'-Bipyridine, 3-iodo- and 3-Iodo-2,2'-bipyridine.

What is the molecular formula of 3-Iodo-2,2'-bipyridine?

The molecular formula of 3-Iodo-2,2'-bipyridine is C10H7IN2.

What is the predicted boiling point of 3-Iodo-2,2'-bipyridine?

The predicted boiling point of 3-Iodo-2,2'-bipyridine is 358.0 ± 32.0 °C.

What is the predicted pka value of 3-Iodo-2,2'-bipyridine?

The predicted pka value of 3-Iodo-2,2'-bipyridine is 3.59 ± 0.22.

What is the predicted density of 3-Iodo-2,2'-bipyridine?

The predicted density of 3-Iodo-2,2'-bipyridine is 1.728 ± 0.06 g/cm3.

How is 3-Iodo-2,2'-bipyridine represented in chemical notation?

3-Iodo-2,2'-bipyridine is represented by the chemical notation C10H7IN2.

What is the significance of the iodine atom in 3-Iodo-2,2'-bipyridine?

The iodine atom in 3-Iodo-2,2'-bipyridine provides a distinctive property and reactivity compared to other bipyridine compounds.

How does the predicted boiling point of 3-Iodo-2,2'-bipyridine compare to other similar compounds?

The predicted boiling point of 3-Iodo-2,2'-bipyridine can be used for comparison and evaluation of its stability and handling requirements in comparison to other similar compounds.