3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate

Catalog Number	ACMA00041010
Molecular Weight	331.10
Molecular Formula	C15H19BF4NP
Purity	97%

Q&A

What is the molecular formula of 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

The molecular formula is C15H19BF4NP.

What is the exact mass of 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

The exact mass is 331.1284294 g/mol.

How many heavy atoms are present in the compound?

There are 22 heavy atoms.

What is the computed formal charge of 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

The computed formal charge is 0.

How many hydrogen bond acceptor counts are there in the compound?

There are 5 hydrogen bond acceptor counts.

What is the canonical SMILES for 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

[B-](F)(F)(F)F.C1=CC=C(C=C1)P(CCC[NH3+])C2=CC=CC=C2

What is the computed complexity of 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

The computed complexity is 196.

What is the IUPAC name of the compound?

The IUPAC name is 3-diphenylphosphanylpropylazanium;tetrafluoroborate.

How many rotatable bond counts are there in the compound?

There are 5 rotatable bond counts.

What is the InChIKey for 3-(Diphenylphosphanyl)propan-1-aminium tetrafluoroborate?

The InChIKey is DQEGSBMYLPJDIY-UHFFFAOYSA-O.